EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O5 |
| Net Charge | 0 |
| Average Mass | 338.359 |
| Monoisotopic Mass | 338.11542 |
| SMILES | COc1cc(-c2ccc(O)cc2)c(OC)c(O)c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C20H18O5/c1-24-17-11-16(12-3-7-14(21)8-4-12)20(25-2)19(23)18(17)13-5-9-15(22)10-6-13/h3-11,21-23H,1-2H3 |
| InChIKey | YNEMPXKRLPZFAX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus taichungensis (ncbitaxon:482145) | mycelium (BTO:0001436) | PubMed (21486068) | EtOAc extract of fungal strain was isolated from root soil of Acrostichum aureum (mangrove plant) Strain: ZHN 7-07 |
| Roles Classification |
|---|
| Biological Roles: | mycotoxin Poisonous substance produced by fungi. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terphenyllin (CHEBI:67537) has role Aspergillus metabolite (CHEBI:76956) |
| terphenyllin (CHEBI:67537) has role mycotoxin (CHEBI:25442) |
| terphenyllin (CHEBI:67537) is a para-terphenyl (CHEBI:75874) |
| terphenyllin (CHEBI:67537) is a dimethoxybenzene (CHEBI:51681) |
| terphenyllin (CHEBI:67537) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| 3-hydroxy-6'-O-desmethylterphenyllin (CHEBI:67400) has functional parent terphenyllin (CHEBI:67537) |
| 3-hydroxyterphenyllin (CHEBI:67536) has functional parent terphenyllin (CHEBI:67537) |
| 3,3''-dihydroxy-6'-O-desmethylterphenyllin (CHEBI:67401) has functional parent terphenyllin (CHEBI:67537) |
| 3,3''-dihydroxyterphenyllin (CHEBI:67538) has functional parent terphenyllin (CHEBI:67537) |
| 4''-deoxyterphenyllin (CHEBI:67535) has functional parent terphenyllin (CHEBI:67537) |
| 6'-O-desmethylterphenyllin (CHEBI:67399) has functional parent terphenyllin (CHEBI:67537) |
| IUPAC Name |
|---|
| 3',6'-dimethoxy-1,1':4',1''-terphenyl-2',4,4''-triol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2013472 | Reaxys |
| CAS:52452-60-5 | ChemIDplus |
| Citations |
|---|