EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16O5 |
| Net Charge | 0 |
| Average Mass | 324.332 |
| Monoisotopic Mass | 324.09977 |
| SMILES | COc1c(-c2ccc(O)cc2)cc(O)c(-c2ccc(O)cc2)c1O |
| InChI | InChI=1S/C19H16O5/c1-24-19-15(11-2-6-13(20)7-3-11)10-16(22)17(18(19)23)12-4-8-14(21)9-5-12/h2-10,20-23H,1H3 |
| InChIKey | ZMEOGHAIJYBVMI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium chermesinum (ncbitaxon:63820) | - | PubMed (21510637) | Ethylacetate extract of endophytic fungus isolated from stem of the mangrove plant Kandelia candel Strain: ZH4 E2 |
| Roles Classification |
|---|
| Biological Roles: | EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6'-O-desmethylterphenyllin (CHEBI:67399) has functional parent terphenyllin (CHEBI:67537) |
| 6'-O-desmethylterphenyllin (CHEBI:67399) has role Penicillium metabolite (CHEBI:76964) |
| 6'-O-desmethylterphenyllin (CHEBI:67399) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| 6'-O-desmethylterphenyllin (CHEBI:67399) is a para-terphenyl (CHEBI:75874) |
| 6'-O-desmethylterphenyllin (CHEBI:67399) is a guaiacols (CHEBI:134251) |
| 6'-O-desmethylterphenyllin (CHEBI:67399) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 3'-methoxy-1,1':4',1''-terphenyl-2',4,4'',6'-tetrol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21548620 | Reaxys |
| Citations |
|---|