EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H26O6 |
| Net Charge | 0 |
| Average Mass | 434.488 |
| Monoisotopic Mass | 434.17294 |
| SMILES | COc1cc2oc3c(OC)c(-c4ccc(O)c(CC=C(C)C)c4)cc(OC)c3c2cc1O |
| InChI | InChI=1S/C26H26O6/c1-14(2)6-7-16-10-15(8-9-19(16)27)17-12-23(30-4)24-18-11-20(28)22(29-3)13-21(18)32-26(24)25(17)31-5/h6,8-13,27-28H,7H2,1-5H3 |
| InChIKey | HWBQSNYBSJLMIS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus taichungensis (ncbitaxon:482145) | mycelium (BTO:0001436) | PubMed (21486068) | EtOAc extract of fungal strain was isolated from root soil of Acrostichum aureum (mangrove plant) Strain: ZHN 7-07 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prenylcandidusin C (CHEBI:67532) has role Aspergillus metabolite (CHEBI:76956) |
| prenylcandidusin C (CHEBI:67532) has role antineoplastic agent (CHEBI:35610) |
| prenylcandidusin C (CHEBI:67532) is a aromatic ether (CHEBI:35618) |
| prenylcandidusin C (CHEBI:67532) is a dibenzofurans (CHEBI:38922) |
| prenylcandidusin C (CHEBI:67532) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 7-[4-hydroxy-3-(3-methylbut-2-en-1-yl)phenyl]-3,6,9-trimethoxydibenzo[b,d]furan-2-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21577513 | Reaxys |
| Citations |
|---|