EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O |
| Net Charge | 0 |
| Average Mass | 150.221 |
| Monoisotopic Mass | 150.10447 |
| SMILES | Cc1coc2c1CC[C@@H](C)C2 |
| InChI | InChI=1S/C10H14O/c1-7-3-4-9-8(2)6-11-10(9)5-7/h6-7H,3-5H2,1-2H3/t7-/m1/s1 |
| InChIKey | YGWKXXYGDYYFJU-SSDOTTSWSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-menthofuran (CHEBI:6750) is a menthofuran (CHEBI:50542) |
| (+)-menthofuran (CHEBI:6750) is enantiomer of (−)-menthofuran (CHEBI:50544) |
| Incoming Relation(s) |
| (−)-menthofuran (CHEBI:50544) is enantiomer of (+)-menthofuran (CHEBI:6750) |
| IUPAC Name |
|---|
| (6R)-3,6-dimethyl-4,5,6,7-tetrahydro-1-benzofuran |
| Synonyms | Source |
|---|---|
| (+)-3,9-epoxy-p-mentha-3,8-diene | ChemIDplus |
| (R)-4,5,6,7-tetrahydro-3,6-dimethylbenzofuran | ChemIDplus |
| Menthofuran | KEGG COMPOUND |
| (R)-Menthofuran | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (R)-menthofuran | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C18025 | KEGG COMPOUND |
| LMPR0102090020 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6053324 | Reaxys |
| CAS:17957-94-7 | ChemIDplus |