EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50542 - menthofuran
| Formula | C10H14O |
| Net Charge | 0 |
| Average Mass | 150.221 |
| Monoisotopic Mass | 150.10447 |
| SMILES | Cc1coc2c1CCC(C)C2 |
| InChI | InChI=1S/C10H14O/c1-7-3-4-9-8(2)6-11-10(9)5-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | YGWKXXYGDYYFJU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| menthofuran (CHEBI:50542) has role nematicide (CHEBI:25491) |
| menthofuran (CHEBI:50542) has role plant metabolite (CHEBI:76924) |
| menthofuran (CHEBI:50542) is a 1-benzofurans (CHEBI:38830) |
| menthofuran (CHEBI:50542) is a monoterpenoid (CHEBI:25409) |
| Incoming Relation(s) |
| (+)-menthofuran (CHEBI:6750) is a menthofuran (CHEBI:50542) |
| (−)-menthofuran (CHEBI:50544) is a menthofuran (CHEBI:50542) |
| IUPAC Name |
|---|
| 3,6-dimethyl-4,5,6,7-tetrahydro-1-benzofuran |
| Synonyms | Source |
|---|---|
| 3,9-epoxy-p-mentha-3,8-diene | NIST Chemistry WebBook |
| 4,5,6,7-tetrahydro-3,6-dimethylbenzofuran | ChemIDplus |
| 4,5,6,7-tetrahydro-3,6-dimethylcoumarone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C09868 | KEGG COMPOUND |
| Menthofuran | Wikipedia |
| C00003049 | KNApSAcK |
| Citations |
|---|