EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O6 |
| Net Charge | 0 |
| Average Mass | 342.347 |
| Monoisotopic Mass | 342.11034 |
| SMILES | COc1cc(OC)c2c(c1)O/C(=C\c1ccc(OC)c(OC)c1)C2=O |
| InChI | InChI=1S/C19H18O6/c1-21-12-9-15(24-4)18-16(10-12)25-17(19(18)20)8-11-5-6-13(22-2)14(7-11)23-3/h5-10H,1-4H3/b17-8- |
| InChIKey | CVKDSGICIOMAGA-IUXPMGMMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyperus teneriffae (IPNI:306106-1) | root (BTO:0001188) | PubMed (21504148) | Ethanolic extract of dried roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,6,3',4'-tetramethoxyaurone (CHEBI:67495) has functional parent aureusidin (CHEBI:18149) |
| 4,6,3',4'-tetramethoxyaurone (CHEBI:67495) has role plant metabolite (CHEBI:76924) |
| 4,6,3',4'-tetramethoxyaurone (CHEBI:67495) is a methoxyaurone (CHEBI:85967) |
| IUPAC Name |
|---|
| (2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-4,6-dimethoxy-1-benzofuran-3(2H)-one |
| Synonym | Source |
|---|---|
| Aureusidin tetramethyl ether | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:46631 | Reaxys |
| Citations |
|---|