EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O6 |
| Net Charge | 0 |
| Average Mass | 286.239 |
| Monoisotopic Mass | 286.04774 |
| SMILES | O=C1/C(=C/c2ccc(O)c(O)c2)Oc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C15H10O6/c16-8-5-11(19)14-12(6-8)21-13(15(14)20)4-7-1-2-9(17)10(18)3-7/h1-6,16-19H/b13-4- |
| InChIKey | WBEFUVAYFSOUEA-PQMHYQBVSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aureusidin (CHEBI:18149) has functional parent aurone (CHEBI:47964) |
| aureusidin (CHEBI:18149) has role plant metabolite (CHEBI:76924) |
| aureusidin (CHEBI:18149) is a hydroxyaurone (CHEBI:85970) |
| aureusidin (CHEBI:18149) is conjugate acid of aureusidin-6-olate (CHEBI:58393) |
| Incoming Relation(s) |
| 4,6,3',4'-tetramethoxyaurone (CHEBI:67495) has functional parent aureusidin (CHEBI:18149) |
| aureusidin 6-O-β-glucoside (CHEBI:66905) has functional parent aureusidin (CHEBI:18149) |
| aureusidin-6-olate (CHEBI:58393) is conjugate base of aureusidin (CHEBI:18149) |
| IUPAC Name |
|---|
| (2Z)-2-[(3,4-dihydroxyphenyl)methylidene]-4,6-dihydroxy-1-benzofuran-3(2H)-one |
| Synonym | Source |
|---|---|
| Aureusidin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| aureusidin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:35491 | Reaxys |
| CAS:38216-54-5 | KEGG COMPOUND |
| CAS:38216-54-5 | ChemIDplus |
| Citations |
|---|