EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O12 |
| Net Charge | 0 |
| Average Mass | 464.379 |
| Monoisotopic Mass | 464.09548 |
| SMILES | O=c1c(O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15+,17+,18-,21+/m1/s1 |
| InChIKey | OVSQVDMCBVZWGM-DTGCRPNFSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artemisia capillaris (ncbitaxon:265783) | whole plant (BTO:0001461) | PubMed (21428416) | Hot methanolic extract of dried and ground whole plant |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quercetin 3-O-β-D-galactopyranoside (CHEBI:67486) has role hepatoprotective agent (CHEBI:62868) |
| quercetin 3-O-β-D-galactopyranoside (CHEBI:67486) has role plant metabolite (CHEBI:76924) |
| quercetin 3-O-β-D-galactopyranoside (CHEBI:67486) is a monosaccharide derivative (CHEBI:63367) |
| quercetin 3-O-β-D-galactopyranoside (CHEBI:67486) is a quercetin O-glycoside (CHEBI:76424) |
| quercetin 3-O-β-D-galactopyranoside (CHEBI:67486) is a tetrahydroxyflavone (CHEBI:38684) |
| quercetin 3-O-β-D-galactopyranoside (CHEBI:67486) is a β-D-galactoside (CHEBI:28034) |
| Incoming Relation(s) |
| quercetin 3-(6''-p-hydroxybenzoylgalactoside) (CHEBI:85151) has functional parent quercetin 3-O-β-D-galactopyranoside (CHEBI:67486) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-chromen-3-yl β-D-galactopyranoside |
| Synonyms | Source |
|---|---|
| Hyperin | KEGG COMPOUND |
| quercetin 3-O-galactoside | ChEBI |
| 2-(3,4-dihydroxyphenyl)-3-(β-D-galactopyranosyloxy)-5,7-dihydroxy-4H-1-benzopyran-4-one | ChemIDplus |
| Hyperoside | ChemIDplus |
| Quercetin 3-galactoside | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C10073 | KEGG COMPOUND |
| Hyperoside | Wikipedia |
| LMPK12112041 | LIPID MAPS |
| HMDB0030775 | HMDB |
| C00005372 | KNApSAcK |
| LSM-5907 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:100990 | Reaxys |
| CAS:482-36-0 | ChemIDplus |
| Citations |
|---|