EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21NO5 |
| Net Charge | 0 |
| Average Mass | 343.379 |
| Monoisotopic Mass | 343.14197 |
| SMILES | COc1cc(/C=C/C(=O)NCCc2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C19H21NO5/c1-24-17-11-13(3-6-15(17)21)5-8-19(23)20-10-9-14-4-7-16(22)18(12-14)25-2/h3-8,11-12,21-22H,9-10H2,1-2H3,(H,20,23)/b8-5+ |
| InChIKey | GRXBVKANHNUZNL-VMPITWQZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arcangelisia gusanlung (ncbitaxon:432629) | stem (BTO:0001300) | PubMed (21500777) | MeOH extract of air-dried and smashed stems |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-trans-feruloyl-3-methoxytyramine (CHEBI:67408) has role metabolite (CHEBI:25212) |
| N-trans-feruloyl-3-methoxytyramine (CHEBI:67408) is a hydroxycinnamic acid (CHEBI:24689) |
| Incoming Relation(s) |
| feruloyl-3-methoxytyramine glycoside (CHEBI:142436) has functional parent N-trans-feruloyl-3-methoxytyramine (CHEBI:67408) |
| Synonym | Source |
|---|---|
| (2E)-3-(4-Hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]acrylamide | ChEBI |
| Citations |
|---|