EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H31NO10 |
| Net Charge | 0 |
| Average Mass | 505.520 |
| Monoisotopic Mass | 505.19480 |
| SMILES | COc1cc(CCNC(=O)/C=C/c2ccc(OC3OC(CO)C(O)C(O)C3O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C25H31NO10/c1-33-18-11-15(3-6-16(18)28)9-10-26-21(29)8-5-14-4-7-17(19(12-14)34-2)35-25-24(32)23(31)22(30)20(13-27)36-25/h3-8,11-12,20,22-25,27-28,30-32H,9-10,13H2,1-2H3,(H,26,29)/b8-5+ |
| InChIKey | UYSRWDYTMGBBHP-VMPITWQZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| feruloyl-3-methoxytyramine glycoside (CHEBI:142436) has functional parent N-trans-feruloyl-3-methoxytyramine (CHEBI:67408) |
| feruloyl-3-methoxytyramine glycoside (CHEBI:142436) is a glycoside (CHEBI:24400) |
| feruloyl-3-methoxytyramine glycoside (CHEBI:142436) is a hydroxycinnamic acid (CHEBI:24689) |