EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H14O7 |
| Net Charge | 0 |
| Average Mass | 354.314 |
| Monoisotopic Mass | 354.07395 |
| SMILES | COc1c(-c2ccc(O)c(O)c2)cc(O)c2c1oc1cc(O)c(O)cc12 |
| InChI | InChI=1S/C19H14O7/c1-25-18-9(8-2-3-11(20)12(21)4-8)5-15(24)17-10-6-13(22)14(23)7-16(10)26-19(17)18/h2-7,20-24H,1H3 |
| InChIKey | WWDZIQMPRWVASF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium chermesinum (ncbitaxon:63820) | - | PubMed (21510637) | Ethylacetate extract of endophytic fungus isolated from stem of the mangrove plant Kandelia candel Strain: ZH4 E2 |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6'-desmethylcandidusin B (CHEBI:67403) has role Penicillium metabolite (CHEBI:76964) |
| 6'-desmethylcandidusin B (CHEBI:67403) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| 6'-desmethylcandidusin B (CHEBI:67403) is a aromatic ether (CHEBI:35618) |
| 6'-desmethylcandidusin B (CHEBI:67403) is a dibenzofurans (CHEBI:38922) |
| 6'-desmethylcandidusin B (CHEBI:67403) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 3-(3,4-dihydroxyphenyl)-4-methoxydibenzo[b,d]furan-1,7,8-triol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8084116 | Reaxys |
| Citations |
|---|