EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H14O6 |
| Net Charge | 0 |
| Average Mass | 338.315 |
| Monoisotopic Mass | 338.07904 |
| SMILES | COc1c(-c2ccc(O)cc2)cc(O)c2c1oc1cc(O)c(O)cc12 |
| InChI | InChI=1S/C19H14O6/c1-24-18-11(9-2-4-10(20)5-3-9)6-15(23)17-12-7-13(21)14(22)8-16(12)25-19(17)18/h2-8,20-23H,1H3 |
| InChIKey | PLXYXSNSJXMTSA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium chermesinum (ncbitaxon:63820) | - | PubMed (21510637) | Ethylacetate extract of endophytic fungus isolated from stem of the mangrove plant Kandelia candel Strain: ZH4 E2 |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3''-deoxy-6'-O-desmethylcandidusin B (CHEBI:67402) has role Penicillium metabolite (CHEBI:76964) |
| 3''-deoxy-6'-O-desmethylcandidusin B (CHEBI:67402) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| 3''-deoxy-6'-O-desmethylcandidusin B (CHEBI:67402) is a aromatic ether (CHEBI:35618) |
| 3''-deoxy-6'-O-desmethylcandidusin B (CHEBI:67402) is a dibenzofurans (CHEBI:38922) |
| 3''-deoxy-6'-O-desmethylcandidusin B (CHEBI:67402) is a polyphenol (CHEBI:26195) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21548623 | Reaxys |
| Citations |
|---|