EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20O5 |
| Net Charge | 0 |
| Average Mass | 316.353 |
| Monoisotopic Mass | 316.13107 |
| SMILES | [H][C@]1(C(=O)[C@@H](C)CC)C(=O)O[C@@]2(C)C(=O)C=C3C=C(C)OC=C3[C@]12[H] |
| InChI | InChI=1S/C18H20O5/c1-5-9(2)16(20)14-15-12-8-22-10(3)6-11(12)7-13(19)18(15,4)23-17(14)21/h6-9,14-15H,5H2,1-4H3/t9-,14-,15+,18-/m0/s1 |
| InChIKey | MZMGICPQNSXAGE-SRSSHDMCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium chermesinum (ncbitaxon:63820) | - | PubMed (21510637) | Ethylacetate extract of endophytic fungus isolated from stem of the mangrove plant Kandelia candel Strain: ZH4 E2 |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chermesinone B (CHEBI:67397) has role Penicillium metabolite (CHEBI:76964) |
| chermesinone B (CHEBI:67397) is a azaphilone (CHEBI:50941) |
| chermesinone B (CHEBI:67397) is a enone (CHEBI:51689) |
| chermesinone B (CHEBI:67397) is a organic heterotricyclic compound (CHEBI:26979) |
| chermesinone B (CHEBI:67397) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| rel-(6aR,9S,9aS)-3,6a-dimethyl-9-[(2S)-2-methylbutanoyl]-9,9a-dihydro-6H-furo[2,3-h]isochromene-6,8(6aH)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21548619 | Reaxys |
| Citations |
|---|