EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22O4 |
| Net Charge | 0 |
| Average Mass | 290.359 |
| Monoisotopic Mass | 290.15181 |
| SMILES | [H][C@]1(CC(=O)[C@@H](C)CC)C2=COC(C)=CC2=CC(=O)[C@]1(C)O |
| InChI | InChI=1S/C17H22O4/c1-5-10(2)15(18)8-14-13-9-21-11(3)6-12(13)7-16(19)17(14,4)20/h6-7,9-10,14,20H,5,8H2,1-4H3/t10-,14-,17+/m0/s1 |
| InChIKey | ITPVWOANIWCVEO-RMLVOYDJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium chermesinum (ncbitaxon:63820) | - | PubMed (21510637) | Ethylacetate extract of endophytic fungus isolated from stem of the mangrove plant Kandelia candel Strain: ZH4 E2 |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chermesinone A (CHEBI:67396) has role Penicillium metabolite (CHEBI:76964) |
| chermesinone A (CHEBI:67396) is a azaphilone (CHEBI:50941) |
| chermesinone A (CHEBI:67396) is a enone (CHEBI:51689) |
| chermesinone A (CHEBI:67396) is a isochromenes (CHEBI:38761) |
| chermesinone A (CHEBI:67396) is a tertiary alcohol (CHEBI:26878) |
| chermesinone A (CHEBI:67396) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| (7R,8S)-7-hydroxy-3,7-dimethyl-8-[(3S)-3-methyl-2-oxopentyl]-7,8-dihydro-6H-isochromen-6-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21548618 | Reaxys |
| Citations |
|---|