EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H36O7 |
| Net Charge | 0 |
| Average Mass | 544.644 |
| Monoisotopic Mass | 544.24610 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@H](c4ccoc4)OC(=O)[C@@]4([H])O[C@@]34[C@]1(C)[C@H](OC(=O)c1ccccc1)C[C@@]1([H])C(C)(C)C(=O)C=C[C@]21C |
| InChI | InChI=1S/C33H36O7/c1-29(2)22-17-24(38-27(35)19-9-7-6-8-10-19)32(5)21(30(22,3)14-12-23(29)34)11-15-31(4)25(20-13-16-37-18-20)39-28(36)26-33(31,32)40-26/h6-10,12-14,16,18,21-22,24-26H,11,15,17H2,1-5H3/t21-,22+,24-,25+,26-,30-,31+,32+,33-/m1/s1 |
| InChIKey | FJGQKVDLYYRRKR-VHSMAHMUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Azadirachta indica (ncbitaxon:124943) | seed (BTO:0001226) | PubMed (21381696) | Defatted MeOH extract of seeds |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-deacetyl-7-benzoylgedunin (CHEBI:67297) has functional parent gedunin (CHEBI:65954) |
| 7-deacetyl-7-benzoylgedunin (CHEBI:67297) has role antineoplastic agent (CHEBI:35610) |
| 7-deacetyl-7-benzoylgedunin (CHEBI:67297) has role plant metabolite (CHEBI:76924) |
| 7-deacetyl-7-benzoylgedunin (CHEBI:67297) is a benzoate ester (CHEBI:36054) |
| 7-deacetyl-7-benzoylgedunin (CHEBI:67297) is a cyclic terpene ketone (CHEBI:36130) |
| 7-deacetyl-7-benzoylgedunin (CHEBI:67297) is a enone (CHEBI:51689) |
| 7-deacetyl-7-benzoylgedunin (CHEBI:67297) is a epoxide (CHEBI:32955) |
| 7-deacetyl-7-benzoylgedunin (CHEBI:67297) is a furans (CHEBI:24129) |
| 7-deacetyl-7-benzoylgedunin (CHEBI:67297) is a limonoid (CHEBI:39434) |
| 7-deacetyl-7-benzoylgedunin (CHEBI:67297) is a pentacyclic triterpenoid (CHEBI:25872) |
| 7-deacetyl-7-benzoylgedunin (CHEBI:67297) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (4aR,6R,6aS,6bR,7aS,10R,10aS,12aR,12bR)-10-(furan-3-yl)-4,4,6a,10a,12b-pentamethyl-3,8-dioxo-3,4,4a,5,6,6a,7a,8,10,10a,11,12,12a,12b-tetradecahydronaphtho[2,1-f]oxireno[d]isochromen-6-yl benzoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6552768 | Reaxys |
| Citations |
|---|