EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34O7 |
| Net Charge | 0 |
| Average Mass | 482.573 |
| Monoisotopic Mass | 482.23045 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@H](c4ccoc4)OC(=O)[C@H]4O[C@]43[C@]1(C)[C@H](OC(C)=O)C[C@@]1([H])C(C)(C)C(=O)C=C[C@]21C |
| InChI | InChI=1S/C28H34O7/c1-15(29)33-20-13-18-24(2,3)19(30)8-10-25(18,4)17-7-11-26(5)21(16-9-12-32-14-16)34-23(31)22-28(26,35-22)27(17,20)6/h8-10,12,14,17-18,20-22H,7,11,13H2,1-6H3/t17-,18+,20-,21+,22-,25-,26+,27+,28-/m1/s1 |
| InChIKey | YJXDGWUNRYLINJ-BHAPSIHVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Azadirachta indica (ncbitaxon:124943) | |||
| fruit (BTO:0000486) | PubMed (9134742) | ||
| seed (BTO:0001226) | PubMed (21381696) | Defatted MeOH extract of seeds | |
| leaf (BTO:0000713) | PubMed (9134742) | ||
| bark (BTO:0001301) | PubMed (9134742) | ||
| Cedrela odorata (ncbitaxon:124947) | xylem (BTO:0001468) | PubMed (9134742) | Previous component: wood; |
| Cedrela sinensis (ncbitaxon:443222) | cortex (PO:0005708) | PubMed (16989525) | |
| Khaya grandifoliola (IPNI:578853-1) | seed (BTO:0001226) | PubMed (10661881) | |
| Xylocarpus granatum (ncbitaxon:241841) | bark (BTO:0001301) | PubMed (17450509) |
| Roles Classification |
|---|
| Biological Roles: | Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gedunin (CHEBI:65954) has role antimalarial (CHEBI:38068) |
| gedunin (CHEBI:65954) has role antineoplastic agent (CHEBI:35610) |
| gedunin (CHEBI:65954) has role Hsp90 inhibitor (CHEBI:63962) |
| gedunin (CHEBI:65954) has role plant metabolite (CHEBI:76924) |
| gedunin (CHEBI:65954) is a acetate ester (CHEBI:47622) |
| gedunin (CHEBI:65954) is a enone (CHEBI:51689) |
| gedunin (CHEBI:65954) is a epoxide (CHEBI:32955) |
| gedunin (CHEBI:65954) is a furans (CHEBI:24129) |
| gedunin (CHEBI:65954) is a lactone (CHEBI:25000) |
| gedunin (CHEBI:65954) is a limonoid (CHEBI:39434) |
| gedunin (CHEBI:65954) is a organic heteropentacyclic compound (CHEBI:38164) |
| gedunin (CHEBI:65954) is a pentacyclic triterpenoid (CHEBI:25872) |
| Incoming Relation(s) |
| 7-deacetyl-7-benzoylgedunin (CHEBI:67297) has functional parent gedunin (CHEBI:65954) |
| 7-deacetylgedunin (CHEBI:67296) has functional parent gedunin (CHEBI:65954) |
| IUPAC Name |
|---|
| (4aR,6R,6aS,6bR,7aS,10R,10aS,12aR,12bR)-10-(3-furyl)-4,4,6a,10a,12b-pentamethyl-3,8-dioxo-3,4,4a,5,6,6a,7a,8,10,10a,11,12,12a,12b-tetradecahydrooxireno[c]phenanthro[1,2-d]pyran-6-yl acetate |
| Synonyms | Source |
|---|---|
| (−)-gedunin | ChEBI |
| gedunine | ChemIDplus |
| NSC 113497 | ChemIDplus |
| Oxireno(c)phenanthro(1,2-d)pyran-3,8(3aH,4bH)-dione, 5-(acetyloxy)-1-(3-furanyl)-1,5,6,6a,7,10a,10b,11,12,12a-decahydro-4b,7,7,10a,12a-pentamethyl-,(1S,3aS,4aR,4bS,5R,6aR,10aR,10bR,12aS)- | ChEBI |
| D-homo-24-nor-17-oxachola-1,20,22-triene-3,16-dione, 7-(acetyloxy)-14,15:21,23-diepoxy-4,4,8-trimethyl-(5α,7α,13α,14β,15β,17aα)- | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1444894 | Reaxys |
| CAS:2753-30-2 | ChemIDplus |
| Citations |
|---|