EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H36O5 |
| Net Charge | 0 |
| Average Mass | 512.646 |
| Monoisotopic Mass | 512.25627 |
| SMILES | [H][C@]12CC[C@]3(C)C(=CC(=O)[C@@]3([H])c3ccoc3)[C@]1(C)[C@H](OC(=O)c1ccccc1)C[C@@]1([H])C(C)(C)C(=O)C=C[C@]21C |
| InChI | InChI=1S/C33H36O5/c1-30(2)24-18-27(38-29(36)20-9-7-6-8-10-20)33(5)23(31(24,3)15-12-26(30)35)11-14-32(4)25(33)17-22(34)28(32)21-13-16-37-19-21/h6-10,12-13,15-17,19,23-24,27-28H,11,14,18H2,1-5H3/t23-,24+,27-,28-,31-,32-,33-/m1/s1 |
| InChIKey | BNCQITGVZDTXDN-RCNGYQEYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Azadirachta indica (ncbitaxon:124943) | seed (BTO:0001226) | PubMed (21381696) | Defatted MeOH extract of seeds |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-benzoylnimbocinol (CHEBI:67282) has functional parent nimbocinol (CHEBI:67281) |
| 7-benzoylnimbocinol (CHEBI:67282) has role plant metabolite (CHEBI:76924) |
| 7-benzoylnimbocinol (CHEBI:67282) is a benzoate ester (CHEBI:36054) |
| 7-benzoylnimbocinol (CHEBI:67282) is a cyclic terpene ketone (CHEBI:36130) |
| 7-benzoylnimbocinol (CHEBI:67282) is a furans (CHEBI:24129) |
| 7-benzoylnimbocinol (CHEBI:67282) is a limonoid (CHEBI:39434) |
| 7-benzoylnimbocinol (CHEBI:67282) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (5α,7α,13α,17α)-17-(furan-3-yl)-4,4,8-trimethyl-3,16-dioxoandrosta-1,14-dien-7-yl benzoate |
| Synonym | Source |
|---|---|
| 7-desacetyl-7-benzoylazadiradione | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6549952 | Reaxys |
| Citations |
|---|