EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H32O4 |
| Net Charge | 0 |
| Average Mass | 408.538 |
| Monoisotopic Mass | 408.23006 |
| SMILES | [H][C@]12CC[C@]3(C)C(=CC(=O)[C@@]3([H])c3ccoc3)[C@]1(C)[C@H](O)C[C@@]1([H])C(C)(C)C(=O)C=C[C@]21C |
| InChI | InChI=1S/C26H32O4/c1-23(2)18-13-21(29)26(5)17(24(18,3)10-7-20(23)28)6-9-25(4)19(26)12-16(27)22(25)15-8-11-30-14-15/h7-8,10-12,14,17-18,21-22,29H,6,9,13H2,1-5H3/t17-,18+,21-,22-,24-,25-,26-/m1/s1 |
| InChIKey | BAMHPKTZTBFUOH-WWBRISJOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Azadirachta indica (ncbitaxon:124943) | seed (BTO:0001226) | PubMed (21381696) | n-Hexane extract of seeds |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nimbocinol (CHEBI:67281) has role plant metabolite (CHEBI:76924) |
| nimbocinol (CHEBI:67281) is a cyclic terpene ketone (CHEBI:36130) |
| nimbocinol (CHEBI:67281) is a furans (CHEBI:24129) |
| nimbocinol (CHEBI:67281) is a limonoid (CHEBI:39434) |
| nimbocinol (CHEBI:67281) is a tetracyclic triterpenoid (CHEBI:26893) |
| Incoming Relation(s) |
| 7-benzoylnimbocinol (CHEBI:67282) has functional parent nimbocinol (CHEBI:67281) |
| IUPAC Name |
|---|
| (5α,7α,13α,17α)-17-(furan-3-yl)-7-hydroxy-4,4,8-trimethylandrosta-1,14-diene-3,16-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6447097 | Reaxys |
| Citations |
|---|