EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O2 |
| Net Charge | 0 |
| Average Mass | 168.236 |
| Monoisotopic Mass | 168.11503 |
| SMILES | CC(C)=CCC/C(C)=C/C(=O)O |
| InChI | InChI=1S/C10H16O2/c1-8(2)5-4-6-9(3)7-10(11)12/h5,7H,4,6H2,1-3H3,(H,11,12)/b9-7+ |
| InChIKey | ZHYZQXUYZJNEHD-VQHVLOKHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 1.14.18.1 (tyrosinase) inhibitor Any EC 1.14.18.* (oxidoreductase acting on paired donors, miscellaneous compound as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosinase (monophenol monooxygenase), EC 1.14.18.1, an enzyme that catalyses the oxidation of phenols (such as tyrosine) and is widespread in plants and animals. |
| Application: | melanin synthesis inhibitor A depigmentation agent which inhibits the synthesis of melanin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| geranic acid (CHEBI:67264) has role antifungal agent (CHEBI:35718) |
| geranic acid (CHEBI:67264) has role EC 1.14.18.1 (tyrosinase) inhibitor (CHEBI:59997) |
| geranic acid (CHEBI:67264) has role melanin synthesis inhibitor (CHEBI:64933) |
| geranic acid (CHEBI:67264) has role pheromone (CHEBI:26013) |
| geranic acid (CHEBI:67264) has role plant metabolite (CHEBI:76924) |
| geranic acid (CHEBI:67264) is a methyl-branched fatty acid (CHEBI:62499) |
| geranic acid (CHEBI:67264) is a monoterpenoid (CHEBI:25409) |
| geranic acid (CHEBI:67264) is a polyunsaturated fatty acid (CHEBI:26208) |
| geranic acid (CHEBI:67264) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| geranic acid (CHEBI:67264) is conjugate acid of geranate (CHEBI:67260) |
| Incoming Relation(s) |
| geranate (CHEBI:67260) is conjugate base of geranic acid (CHEBI:67264) |
| IUPAC Name |
|---|
| (2E)-3,7-dimethylocta-2,6-dienoic acid |
| Synonyms | Source |
|---|---|
| 3,7-Dimethyl-2E,6-octadienoic acid | LIPID MAPS |
| 3,7-Dimethylocta-2,6-dienoate | KEGG COMPOUND |
| Geranilyc acid | NIST Chemistry WebBook |
| Geranoic acid | NIST Chemistry WebBook |
| (E)-3,7-dimethylocta-2,6-dienoic acid | ChEBI |
| trans-3,7-dimethyl-2,6-octadien-1-oic acid | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C16461 | KEGG COMPOUND |
| CPD-7618 | MetaCyc |
| Geranic_acid | Wikipedia |
| HMDB0036103 | HMDB |
| LMFA01030784 | LIPID MAPS |
| US2008161397 | Patent |
| US2012014883 | Patent |
| Citations |
|---|