EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24O6 |
| Net Charge | 0 |
| Average Mass | 372.417 |
| Monoisotopic Mass | 372.15729 |
| SMILES | COc1cc(CCC(=O)CC(=O)CCc2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C21H24O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h5-6,9-12,24-25H,3-4,7-8,13H2,1-2H3 |
| InChIKey | LBTVHXHERHESKG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrahydrocurcumin (CHEBI:67263) has functional parent curcumin (CHEBI:3962) |
| tetrahydrocurcumin (CHEBI:67263) has role metabolite (CHEBI:25212) |
| tetrahydrocurcumin (CHEBI:67263) is a diarylheptanoid (CHEBI:78802) |
| tetrahydrocurcumin (CHEBI:67263) is a polyphenol (CHEBI:26195) |
| tetrahydrocurcumin (CHEBI:67263) is a β-diketone (CHEBI:67265) |
| IUPAC Name |
|---|
| 1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-dione |
| Synonym | Source |
|---|---|
| 1,7-bis(4-hydroxy-3-methoxyphenyl)-3,5-heptanedione | ChemIDplus |
| UniProt Name | Source |
|---|---|
| tetrahydrocurcumin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-13315 | MetaCyc |
| HMDB0005789 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3485469 | Reaxys |
| CAS:36062-04-1 | ChemIDplus |
| Citations |
|---|