EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O6 |
| Net Charge | 0 |
| Average Mass | 358.390 |
| Monoisotopic Mass | 358.14164 |
| SMILES | [H][C@@]12CO[C@@H](c3ccc(O)c(OC)c3)[C@]1([H])CO[C@H]2c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C20H22O6/c1-23-17-7-11(3-5-15(17)21)19-13-9-26-20(14(13)10-25-19)12-4-6-16(22)18(8-12)24-2/h3-8,13-14,19-22H,9-10H2,1-2H3/t13-,14-,19+,20+/m1/s1 |
| InChIKey | HGXBRUKMWQGOIE-NSMLZSOPSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Machilus robusta (ncbitaxon:460780) | bark (BTO:0001301) | PubMed (21627109) | 95%aqueous EtOH extract of air-dried bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-pinoresinol (CHEBI:67245) has role plant metabolite (CHEBI:76924) |
| (−)-pinoresinol (CHEBI:67245) is a pinoresinol (CHEBI:8225) |
| Incoming Relation(s) |
| (−)-demethoxylpinoresinol (CHEBI:65738) has functional parent (−)-pinoresinol (CHEBI:67245) |
| IUPAC Name |
|---|
| (7β,7'β,8β,8'β)-3,3'-dimethoxy-7,9':7',9-diepoxylignane-4,4'-diol |
| Synonym | Source |
|---|---|
| 4,4'-(1R,3aS,4R,6aS)-tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diylbis(2-methoxyphenol) | IUPAC |
| UniProt Name | Source |
|---|---|
| (−)-pinoresinol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-8906 | MetaCyc |
| Pinoresinol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4238047 | Reaxys |
| Citations |
|---|