EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20O5 |
| Net Charge | 0 |
| Average Mass | 328.364 |
| Monoisotopic Mass | 328.13107 |
| SMILES | [H][C@@]12CO[C@@H](c3ccc(O)c(OC)c3)[C@]1([H])CO[C@H]2c1ccc(O)cc1 |
| InChI | InChI=1S/C19H20O5/c1-22-17-8-12(4-7-16(17)21)19-15-10-23-18(14(15)9-24-19)11-2-5-13(20)6-3-11/h2-8,14-15,18-21H,9-10H2,1H3/t14-,15-,18+,19+/m1/s1 |
| InChIKey | GDSWNXUTRVITEP-LTDCPUDJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Balanophora abbreviata (IPNI:103224-1) | whole plant (BTO:0001461) | PubMed (15467252) |
| Roles Classification |
|---|
| Biological Roles: | EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-demethoxylpinoresinol (CHEBI:65738) has functional parent (−)-pinoresinol (CHEBI:67245) |
| (−)-demethoxylpinoresinol (CHEBI:65738) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| (−)-demethoxylpinoresinol (CHEBI:65738) has role plant metabolite (CHEBI:76924) |
| (−)-demethoxylpinoresinol (CHEBI:65738) is a aromatic ether (CHEBI:35618) |
| (−)-demethoxylpinoresinol (CHEBI:65738) is a furofuran (CHEBI:47790) |
| (−)-demethoxylpinoresinol (CHEBI:65738) is a lignan (CHEBI:25036) |
| (−)-demethoxylpinoresinol (CHEBI:65738) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 4-[(1R,3aS,4R,6aS)-4-(4-hydroxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-2-methoxyphenol |
| Citations |
|---|