EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O5 |
| Net Charge | 0 |
| Average Mass | 162.141 |
| Monoisotopic Mass | 162.05282 |
| SMILES | O[C@@H]1[C@@H](O)[C@H](O)[C@@H]2O[C@@H]2[C@H]1O |
| InChI | InChI=1S/C6H10O5/c7-1-2(8)4(10)6-5(11-6)3(1)9/h1-10H/t1-,2-,3+,4+,5-,6+/m1/s1 |
| InChIKey | ZHMWOVGZCINIHW-JIGFOQOZSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-L-1,2-anhydro-myo-inositol (CHEBI:67234) has functional parent (−)-conduritol B (CHEBI:67226) |
| 1-L-1,2-anhydro-myo-inositol (CHEBI:67234) is a conduritol epoxide (CHEBI:67235) |
| 1-L-1,2-anhydro-myo-inositol (CHEBI:67234) is enantiomer of 1-D-1,2-anhydro-myo-inositol (CHEBI:67233) |
| Incoming Relation(s) |
| conduritol B epoxide (CHEBI:67229) has part 1-L-1,2-anhydro-myo-inositol (CHEBI:67234) |
| 1-D-1,2-anhydro-myo-inositol (CHEBI:67233) is enantiomer of 1-L-1,2-anhydro-myo-inositol (CHEBI:67234) |
| IUPAC Name |
|---|
| (1R,2S,3R,4R,5S,6S)-7-oxabicyclo[4.1.0]heptane-2,3,4,5-tetrol |
| Synonym | Source |
|---|---|
| 1L-conduritol B epoxide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1281440 | Reaxys |
| Citations |
|---|