EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O4 |
| Net Charge | 0 |
| Average Mass | 146.142 |
| Monoisotopic Mass | 146.05791 |
| SMILES | O[C@@H]1[C@@H](O)[C@H](O)C=C[C@H]1O |
| InChI | InChI=1S/C6H10O4/c7-3-1-2-4(8)6(10)5(3)9/h1-10H/t3-,4-,5+,6+/m1/s1 |
| InChIKey | LRUBQXAKGXQBHA-ZXXMMSQZSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-conduritol B (CHEBI:67226) is a conduritol (CHEBI:67218) |
| (−)-conduritol B (CHEBI:67226) is enantiomer of (+)-conduritol B (CHEBI:67224) |
| Incoming Relation(s) |
| 1-L-1,2-anhydro-myo-inositol (CHEBI:67234) has functional parent (−)-conduritol B (CHEBI:67226) |
| conduritol B (CHEBI:67222) has part (−)-conduritol B (CHEBI:67226) |
| (+)-conduritol B (CHEBI:67224) is enantiomer of (−)-conduritol B (CHEBI:67226) |
| IUPAC Name |
|---|
| (1R,2S,3S,4R)-cyclohex-5-ene-1,2,3,4-tetrol |
| Synonyms | Source |
|---|---|
| (1R,2S,3S,4R)-1,2,3,4,tetrahydroxy-5-cyclohexene | ChEBI |
| (−)-L-conduritol B | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2613487 | Reaxys |