EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32O4 |
| Net Charge | 0 |
| Average Mass | 384.516 |
| Monoisotopic Mass | 384.23006 |
| SMILES | [H][C@@]12C=C(C)C3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1(OC(C)=O)C(C)=O |
| InChI | InChI=1S/C24H32O4/c1-14-12-18-19(22(4)9-6-17(27)13-21(14)22)7-10-23(5)20(18)8-11-24(23,15(2)25)28-16(3)26/h12-13,18-20H,6-11H2,1-5H3/t18-,19+,20+,22-,23+,24+/m1/s1 |
| InChIKey | RQZAXGRLVPAYTJ-GQFGMJRRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | progestin A synthetic progestogen. |
| Applications: | synthetic oral contraceptive An oral contraceptive which owes its effectiveness to synthetic preparation. appetite enhancer A drug which increases appetite. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. contraceptive drug A chemical substance that prevents or reduces the probability of conception. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| megestrol acetate (CHEBI:6723) has functional parent megestrol (CHEBI:6722) |
| megestrol acetate (CHEBI:6723) has role antineoplastic agent (CHEBI:35610) |
| megestrol acetate (CHEBI:6723) has role appetite enhancer (CHEBI:50779) |
| megestrol acetate (CHEBI:6723) has role contraceptive drug (CHEBI:49323) |
| megestrol acetate (CHEBI:6723) has role progestin (CHEBI:59826) |
| megestrol acetate (CHEBI:6723) has role synthetic oral contraceptive (CHEBI:49326) |
| megestrol acetate (CHEBI:6723) is a 20-oxo steroid (CHEBI:36885) |
| megestrol acetate (CHEBI:6723) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| megestrol acetate (CHEBI:6723) is a acetate ester (CHEBI:47622) |
| megestrol acetate (CHEBI:6723) is a steroid ester (CHEBI:47880) |
| IUPAC Name |
|---|
| 6-methyl-3,20-dioxopregna-4,6-dien-17-yl acetate |
| Synonyms | Source |
|---|---|
| 17-acetoxy-6-methylpregna-4,6-diene-3,20-dione | ChemIDplus |
| 17-hydroxy-6-methylpregna-4,6-diene-3,20-dione 17-acetate | ChemIDplus |
| 17α-acetoxy-6-dehydro-6-methylprogesterone | ChemIDplus |
| 17α-hydroxy-6-methylpregna-4,6-diene-3,20-dione acetate | ChemIDplus |
| 6-dehydro-6-methyl-17α-acetoxyprogesterone | ChemIDplus |
| 6-methyl-17α-acetoxypregna-4,6-diene-3,20-dione | ChemIDplus |
| Brand Names | Source |
|---|---|
| magestin | ChemIDplus |
| Magestin | DrugBank |
| Maygace | DrugBank |
| Megace | DrugBank |
| Megeron | ChemIDplus |
| Megestat | DrugBank |
| Citations |
|---|