EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O3 |
| Net Charge | 0 |
| Average Mass | 342.479 |
| Monoisotopic Mass | 342.21949 |
| SMILES | [H][C@@]12C=C(C)C3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1(O)C(C)=O |
| InChI | InChI=1S/C22H30O3/c1-13-11-16-17(20(3)8-5-15(24)12-19(13)20)6-9-21(4)18(16)7-10-22(21,25)14(2)23/h11-12,16-18,25H,5-10H2,1-4H3/t16-,17+,18+,20-,21+,22+/m1/s1 |
| InChIKey | VXIMPSPISRVBPZ-NWUMPJBXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | progestin A synthetic progestogen. |
| Applications: | contraceptive drug A chemical substance that prevents or reduces the probability of conception. appetite enhancer A drug which increases appetite. synthetic oral contraceptive An oral contraceptive which owes its effectiveness to synthetic preparation. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| megestrol (CHEBI:6722) has role antineoplastic agent (CHEBI:35610) |
| megestrol (CHEBI:6722) has role appetite enhancer (CHEBI:50779) |
| megestrol (CHEBI:6722) has role contraceptive drug (CHEBI:49323) |
| megestrol (CHEBI:6722) has role progestin (CHEBI:59826) |
| megestrol (CHEBI:6722) has role synthetic oral contraceptive (CHEBI:49326) |
| megestrol (CHEBI:6722) is a 17α-hydroxy steroid (CHEBI:35342) |
| megestrol (CHEBI:6722) is a 20-oxo steroid (CHEBI:36885) |
| megestrol (CHEBI:6722) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| megestrol (CHEBI:6722) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| Incoming Relation(s) |
| megestrol acetate (CHEBI:6723) has functional parent megestrol (CHEBI:6722) |
| IUPAC Name |
|---|
| 17-hydroxy-6-methylpregna-4,6-diene-3,20-dione |
| INNs | Source |
|---|---|
| megestrol | ChEBI |
| mégestrol | ChEBI |
| megestrolum | ChEBI |
| Synonyms | Source |
|---|---|
| 17-Hydroxy-6-methylpregna-4,6-diene-3,20-dione | ChemIDplus |
| Megestrol | KEGG COMPOUND |
| megestrolo | ChemIDplus |
| Brand Names | Source |
|---|---|
| Magestin | DrugBank |
| Megeron | DrugBank |
| Niagestin | DrugBank |
| Ovaban | DrugBank |
| Ovarid | DrugBank |
| Volidan | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| C07120 | KEGG COMPOUND |
| D08167 | KEGG DRUG |
| DB00351 | DrugBank |
| HMDB0014495 | HMDB |
| LMST02030177 | LIPID MAPS |
| Megestrol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3164843 | Reaxys |
| CAS:3562-63-8 | ChemIDplus |
| Citations |
|---|