EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H34N2O4 |
| Net Charge | 0 |
| Average Mass | 486.612 |
| Monoisotopic Mass | 486.25186 |
| SMILES | [H][C@@]12CC(=O)[C@H](c3ccc4ccncc4c3)[C@@]1(C)CC=C1C=C3[C@@H](O)[C@H](O)[C@@H](N(C)C)C[C@]34CC[C@@]12O4 |
| InChI | InChI=1S/C30H34N2O4/c1-28-8-6-20-13-21-26(34)27(35)22(32(2)3)15-29(21)9-10-30(20,36-29)24(28)14-23(33)25(28)18-5-4-17-7-11-31-16-19(17)12-18/h4-7,11-13,16,22,24-27,34-35H,8-10,14-15H2,1-3H3/t22-,24+,25-,26+,27+,28-,29+,30+/m0/s1 |
| InChIKey | WMKCSKJMIPEVOG-HIGLSOHYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | angiogenesis modulating agent An agent that modulates the physiologic angiogenesis process. This is accomplished by endogenous angiogenic proteins and a variety of other chemicals and pharmaceutical agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cortistatin C (CHEBI:67174) has functional parent cortistatin B (CHEBI:67173) |
| cortistatin C (CHEBI:67174) is a cortistatins (CHEBI:67169) |
| cortistatin C (CHEBI:67174) is a cyclic ketone (CHEBI:3992) |
| cortistatin C (CHEBI:67174) is a diol (CHEBI:23824) |
| cortistatin C (CHEBI:67174) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| cortistatin D (CHEBI:67175) has functional parent cortistatin C (CHEBI:67174) |
| IUPAC Name |
|---|
| (1R,2R,3S,5R)-3-(dimethylamino)-1,2-dihydroxy-17β-(isoquinolin-7-yl)-5,8α-epoxy-9,19-cyclo-9,10-secoandrosta-9(11),10-dien-16-one |
| Synonyms | Source |
|---|---|
| (1R,2R,3S,5R,8α,17β)-3-(dimethylamino)-1,2-dihydroxy-17-(isoquinolin-7-yl)-5,8-epoxy-9,19-cyclo-9,10-secoandrosta-9(11),10-dien-16-one | IUPAC |
| (−)-cortistatin C | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10502498 | Reaxys |
| Citations |
|---|