EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H18O6S2 |
| Net Charge | 0 |
| Average Mass | 274.360 |
| Monoisotopic Mass | 274.05448 |
| SMILES | CC(CCC(C)OS(C)(=O)=O)OS(C)(=O)=O |
| InChI | InChI=1S/C8H18O6S2/c1-7(13-15(3,9)10)5-6-8(2)14-16(4,11)12/h7-8H,5-6H2,1-4H3 |
| InChIKey | JDZNTUQRMDAIRO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethylmyleran (CHEBI:67107) has role alkylating agent (CHEBI:22333) |
| dimethylmyleran (CHEBI:67107) has role mutagen (CHEBI:25435) |
| dimethylmyleran (CHEBI:67107) is a methanesulfonate ester (CHEBI:25223) |
| IUPAC Name |
|---|
| hexane-2,5-diyl dimethanesulfonate |
| Synonyms | Source |
|---|---|
| 1,4-bis(methylsulfonyloxy)-1,4-dimethylbutane | ChemIDplus |
| 1,4-dimethanesulfonoxy-1,4-dimethylbutane | ChemIDplus |
| 1,4-dimethylbusulfan | ChEBI |
| 1,4-dimethylmyleran | ChEBI |
| 2,5-dimethanesulfomyloxyhexane | ChemIDplus |
| 2,5-hexanediol dimesylate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1796040 | Reaxys |
| CAS:55-93-6 | ChemIDplus |
| Citations |
|---|