EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15N4O2 |
| Net Charge | -1 |
| Average Mass | 187.223 |
| Monoisotopic Mass | 187.12005 |
| SMILES | CNC(=N)NCCC[C@H](N)C(=O)[O-] |
| InChI | InChI=1S/C7H16N4O2/c1-10-7(9)11-4-2-3-5(8)6(12)13/h5H,2-4,8H2,1H3,(H,12,13)(H3,9,10,11)/p-1/t5-/m0/s1 |
| InChIKey | NTNWOCRCBQPEKQ-YFKPBYRVSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nω-methyl-L-argininate (CHEBI:67015) is a L-α-amino acid anion (CHEBI:59814) |
| Nω-methyl-L-argininate (CHEBI:67015) is conjugate base of Nω-methyl-L-arginine (CHEBI:28229) |
| Incoming Relation(s) |
| Nω-methyl-L-arginine (CHEBI:28229) is conjugate acid of Nω-methyl-L-argininate (CHEBI:67015) |
| IUPAC Names |
|---|
| (2S)-2-amino-5-(N'-methylcarbamimidamido)pentanoate |
| (2S)-2-amino-5-{[imino(methylamino)methyl]amino}pentanoate |
| N5-(N-methylcarbamimidoyl)-L-ornithinate |
| N5-[imino(methylamino)methyl]-L-ornithinate |