EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H16N4O2 |
| Net Charge | 0 |
| Average Mass | 188.231 |
| Monoisotopic Mass | 188.12733 |
| SMILES | CNC(=N)NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H16N4O2/c1-10-7(9)11-4-2-3-5(8)6(12)13/h5H,2-4,8H2,1H3,(H,12,13)(H3,9,10,11)/t5-/m0/s1 |
| InChIKey | NTNWOCRCBQPEKQ-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. anticholesteremic drug A substance used to lower plasma cholesterol levels. hepatoprotective agent Any compound that is able to prevent damage to the liver. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nω-methyl-L-arginine (CHEBI:28229) has role anti-anaemic agent (CHEBI:75835) |
| Nω-methyl-L-arginine (CHEBI:28229) has role anti-HIV agent (CHEBI:64946) |
| Nω-methyl-L-arginine (CHEBI:28229) has role anticholesteremic drug (CHEBI:35821) |
| Nω-methyl-L-arginine (CHEBI:28229) has role antihypertensive agent (CHEBI:35674) |
| Nω-methyl-L-arginine (CHEBI:28229) has role antineoplastic agent (CHEBI:35610) |
| Nω-methyl-L-arginine (CHEBI:28229) has role cardiovascular drug (CHEBI:35554) |
| Nω-methyl-L-arginine (CHEBI:28229) has role hepatoprotective agent (CHEBI:62868) |
| Nω-methyl-L-arginine (CHEBI:28229) is a L-arginine derivative (CHEBI:83965) |
| Nω-methyl-L-arginine (CHEBI:28229) is a guanidines (CHEBI:24436) |
| Nω-methyl-L-arginine (CHEBI:28229) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Nω-methyl-L-arginine (CHEBI:28229) is conjugate acid of Nω-methyl-L-argininate (CHEBI:67015) |
| Nω-methyl-L-arginine (CHEBI:28229) is tautomer of Nω-methyl-L-arginine zwitterion (CHEBI:60257) |
| Incoming Relation(s) |
| Nω-methyl-L-argininate (CHEBI:67015) is conjugate base of Nω-methyl-L-arginine (CHEBI:28229) |
| Nω-methyl-L-arginine zwitterion (CHEBI:60257) is tautomer of Nω-methyl-L-arginine (CHEBI:28229) |
| IUPAC Names |
|---|
| (2S)-2-amino-5-(N'-methylcarbamimidamido)pentanoic acid |
| (2S)-2-amino-5-{[imino(methylamino)methyl]amino}pentanoic acid |
| N5-(N-methylcarbamimidoyl)-L-ornithine |
| N5-[imino(methylamino)methyl]-L-ornithine |
| INNs | Source |
|---|---|
| tilarginina | ChEBI |
| tilarginine | ChemIDplus |
| tilargininum | ChEBI |
| Synonyms | Source |
|---|---|
| acide (2S)-2-amino-5-(3-méthylguanidino)pentanoïque | ChEBI |
| N-monomethyl-L-arginine | ChemIDplus |
| N5-(methylamidino)-L-ornithine | ChemIDplus |
| N5-(metilamidino)-L-ornitina | ChEBI |
| NG-monomethyl-L-arginine | ChemIDplus |
| Ngamma-Monomethyl-L-arginine | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2262067 | Beilstein |
| CAS:17035-90-4 | ChemIDplus |
| Citations |
|---|