EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H22N3O3 |
| Net Charge | -1 |
| Average Mass | 232.304 |
| Monoisotopic Mass | 232.16667 |
| SMILES | NCC[C@@H](O)CNCCCC[C@H](N)C(=O)[O-] |
| InChI | InChI=1S/C10H23N3O3/c11-5-4-8(14)7-13-6-2-1-3-9(12)10(15)16/h8-9,13-14H,1-7,11-12H2,(H,15,16)/p-1/t8-,9+/m1/s1 |
| InChIKey | BZUIJMCJNWUGKQ-BDAKNGLRSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hypusinate (CHEBI:67001) is a L-α-amino acid anion (CHEBI:59814) |
| hypusinate (CHEBI:67001) is conjugate base of hypusine (CHEBI:21858) |
| Incoming Relation(s) |
| hypusine (CHEBI:21858) is conjugate acid of hypusinate (CHEBI:67001) |
| IUPAC Name |
|---|
| (2S)-2-amino-6-{[(2R)-4-amino-2-hydroxybutyl]amino}hexanoate |
| Synonym | Source |
|---|---|
| N6-[(2R)-4-amino-2-hydroxybutyl]-L-lysinate | ChEBI |