EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H23N3O3 |
| Net Charge | 0 |
| Average Mass | 233.312 |
| Monoisotopic Mass | 233.17394 |
| SMILES | NCC[C@@H](O)CNCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H23N3O3/c11-5-4-8(14)7-13-6-2-1-3-9(12)10(15)16/h8-9,13-14H,1-7,11-12H2,(H,15,16)/t8-,9+/m1/s1 |
| InChIKey | BZUIJMCJNWUGKQ-BDAKNGLRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hypusine (CHEBI:21858) is a L-lysine derivative (CHEBI:25095) |
| hypusine (CHEBI:21858) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| hypusine (CHEBI:21858) is conjugate acid of hypusinate (CHEBI:67001) |
| Incoming Relation(s) |
| deoxyhypusine (CHEBI:50038) has functional parent hypusine (CHEBI:21858) |
| hypusinate (CHEBI:67001) is conjugate base of hypusine (CHEBI:21858) |
| hypusine residue (CHEBI:64640) is substituent group from hypusine (CHEBI:21858) |
| IUPAC Name |
|---|
| N6-[(2R)-4-amino-2-hydroxybutyl]-L-lysine |
| Synonym | Source |
|---|---|
| (+)-hypusine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 5CT | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:34994-11-1 | ChemIDplus |
| Citations |
|---|