EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O6 |
| Net Charge | 0 |
| Average Mass | 358.390 |
| Monoisotopic Mass | 358.14164 |
| SMILES | COc1cc(C[C@H]2COC(=O)[C@@H]2Cc2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C20H22O6/c1-24-18-9-12(3-5-16(18)21)7-14-11-26-20(23)15(14)8-13-4-6-17(22)19(10-13)25-2/h3-6,9-10,14-15,21-22H,7-8,11H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | MATGKVZWFZHCLI-LSDHHAIUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. phytoestrogen Any compound produced by a plant that happens to have estrogenic activity. |
| Applications: | anti-asthmatic agent Any compound that has anti-asthmatic effects. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-matairesinol (CHEBI:6698) has role angiogenesis inhibitor (CHEBI:48422) |
| (−)-matairesinol (CHEBI:6698) has role anti-asthmatic agent (CHEBI:65023) |
| (−)-matairesinol (CHEBI:6698) has role phytoestrogen (CHEBI:76989) |
| (−)-matairesinol (CHEBI:6698) has role plant metabolite (CHEBI:76924) |
| (−)-matairesinol (CHEBI:6698) is a lignan (CHEBI:25036) |
| (−)-matairesinol (CHEBI:6698) is a polyphenol (CHEBI:26195) |
| (−)-matairesinol (CHEBI:6698) is a γ-lactone (CHEBI:37581) |
| Incoming Relation(s) |
| matairesinoside (CHEBI:132820) has functional parent (−)-matairesinol (CHEBI:6698) |
| IUPAC Name |
|---|
| (3R,4R)-3,4-bis(4-hydroxy-3-methoxybenzyl)dihydrofuran-2(3H)-one |
| Synonyms | Source |
|---|---|
| Matairesinol | KEGG COMPOUND |
| Artigenin congener | DrugBank |
| 3R,4R-Bis((4-hydroxy-3-methoxyphenyl)methyl)dihydro-2(3H)-furanone | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (−)-matairesinol | UniProt |
| Citations |
|---|