EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H32O11 |
| Net Charge | 0 |
| Average Mass | 520.531 |
| Monoisotopic Mass | 520.19446 |
| SMILES | COc1cc(C[C@H]2COC(=O)[C@@H]2Cc2ccc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C26H32O11/c1-33-19-9-13(3-5-17(19)28)7-15-12-35-25(32)16(15)8-14-4-6-18(20(10-14)34-2)36-26-24(31)23(30)22(29)21(11-27)37-26/h3-6,9-10,15-16,21-24,26-31H,7-8,11-12H2,1-2H3/t15-,16+,21+,22+,23-,24+,26+/m0/s1 |
| InChIKey | AAGCATAPYOEULE-LHHMAMHXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Styrax japonica (ncbitaxon:59680) | bark (BTO:0001301) | PubMed (15577246) | |
| Symplocos caudata (ncbitaxon:239693) | root (BTO:0001188) | PubMed (17905350) | |
| Cupressus duclouxiana (ncbitaxon:103966) | |||
| branch (BTO:0000148) | PubMed (16753802) | ||
| leaf (BTO:0000713) | PubMed (16753802) | ||
| Plectocephalus americanus (ncbitaxon:41506) | seed (BTO:0001226) | PubMed (16996096) | |
| Cirsium arvense (ncbitaxon:41550) | fruit (BTO:0000486) | PubMed (22396124) | |
| Forsythia viridissima (ncbitaxon:205691) | flower (BTO:0000469) | PubMed (15481244) | |
| Arctium lappa (ncbitaxon:4217) | fruit (BTO:0000486) | PubMed (22396124) | |
| Centaurea scabiosa (ncbitaxon:145517) | fruit (BTO:0000486) | PubMed (22396124) | |
| Saussurea salicifolia (ncbitaxon:446849) | aerial part (BTO:0001658) | PubMed (18057725) | |
| Styrax perkinsiae (ncbitaxon:153547) | bark (BTO:0001301) | PubMed (26762060) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| matairesinoside (CHEBI:132820) has functional parent (−)-matairesinol (CHEBI:6698) |
| matairesinoside (CHEBI:132820) has role plant metabolite (CHEBI:76924) |
| matairesinoside (CHEBI:132820) is a guaiacols (CHEBI:134251) |
| matairesinoside (CHEBI:132820) is a lignan (CHEBI:25036) |
| matairesinoside (CHEBI:132820) is a monosaccharide derivative (CHEBI:63367) |
| matairesinoside (CHEBI:132820) is a β-D-glucoside (CHEBI:22798) |
| matairesinoside (CHEBI:132820) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| 4-({(3R,4R)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-2-oxooxolan-3-yl}methyl)-2-methoxyphenyl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| (-)-Matairesinoside | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| 486612 | PubChem Compound |
| C00032004 | KNApSAcK |
| KR20080082106 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1360031 | Reaxys |
| CAS:23202-85-9 | ChemIDplus |
| Citations |
|---|