EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8N3O2 |
| Net Charge | -1 |
| Average Mass | 130.127 |
| Monoisotopic Mass | 130.06220 |
| SMILES | CN(CC(=O)[O-])C(=N)N |
| InChI | InChI=1S/C4H9N3O2/c1-7(4(5)6)2-3(8)9/h2H2,1H3,(H3,5,6)(H,8,9)/p-1 |
| InChIKey | CVSVTCORWBXHQV-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| creatinate (CHEBI:66924) is a monocarboxylic acid anion (CHEBI:35757) |
| creatinate (CHEBI:66924) is conjugate base of creatine (CHEBI:16919) |
| creatinate (CHEBI:66924) is conjugate base of creatine zwitterion (CHEBI:57947) |
| Incoming Relation(s) |
| creatine (CHEBI:16919) is conjugate acid of creatinate (CHEBI:66924) |
| creatine zwitterion (CHEBI:57947) is conjugate acid of creatinate (CHEBI:66924) |
| IUPAC Name |
|---|
| {[imino(amino)methyl](methyl)amino}acetate |
| Synonyms | Source |
|---|---|
| N-[amino(imino)methyl]-N-methylglycinate | ChEBI |
| (N-methylcarbamimidamido)acetate | ChEBI |