EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16919 - creatine
| Formula | C4H9N3O2 |
| Net Charge | 0 |
| Average Mass | 131.135 |
| Monoisotopic Mass | 131.06948 |
| SMILES | CN(CC(=O)O)C(=N)N |
| InChI | InChI=1S/C4H9N3O2/c1-7(4(5)6)2-3(8)9/h2H2,1H3,(H3,5,6)(H,8,9) |
| InChIKey | CVSVTCORWBXHQV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| - | PubMed (7752905) | ||
| blood serum (BTO:0000133) | MetaboLights (MTBLS90) | ||
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| creatine (CHEBI:16919) has role geroprotector (CHEBI:176497) |
| creatine (CHEBI:16919) has role human metabolite (CHEBI:77746) |
| creatine (CHEBI:16919) has role mouse metabolite (CHEBI:75771) |
| creatine (CHEBI:16919) has role neuroprotective agent (CHEBI:63726) |
| creatine (CHEBI:16919) has role nutraceutical (CHEBI:50733) |
| creatine (CHEBI:16919) is a glycine derivative (CHEBI:24373) |
| creatine (CHEBI:16919) is a guanidines (CHEBI:24436) |
| creatine (CHEBI:16919) is conjugate acid of creatinate (CHEBI:66924) |
| creatine (CHEBI:16919) is tautomer of creatine zwitterion (CHEBI:57947) |
| Incoming Relation(s) |
| N-phosphocreatine (CHEBI:17287) has functional parent creatine (CHEBI:16919) |
| creatinine (CHEBI:16737) has functional parent creatine (CHEBI:16919) |
| creatinate (CHEBI:66924) is conjugate base of creatine (CHEBI:16919) |
| creatine zwitterion (CHEBI:57947) is tautomer of creatine (CHEBI:16919) |
| IUPAC Name |
|---|
| N-[amino(imino)methyl]-N-methylglycine |
| Synonyms | Source |
|---|---|
| alpha-Methylguanidino acetic acid | KEGG COMPOUND |
| ((amino(imino)methyl)(methyl)amino)acetic acid | HMDB |
| Creatin | ChemIDplus |
| Creatine | KEGG COMPOUND |
| N-amidinosarcosine | ChemIDplus |
| N-(aminoiminomethyl)-N-methylglycine | NIST Chemistry WebBook |
| Citations |
|---|