EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16919 - creatine
| Formula | C4H9N3O2 |
| Net Charge | 0 |
| Average Mass | 131.135 |
| Monoisotopic Mass | 131.06948 |
| SMILES | CN(CC(=O)O)C(=N)N |
| InChI | InChI=1S/C4H9N3O2/c1-7(4(5)6)2-3(8)9/h2H2,1H3,(H3,5,6)(H,8,9) |
| InChIKey | CVSVTCORWBXHQV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| - | PubMed (7752905) | ||
| blood serum (BTO:0000133) | MetaboLights (MTBLS90) | ||
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| creatine (CHEBI:16919) has role geroprotector (CHEBI:176497) |
| creatine (CHEBI:16919) has role human metabolite (CHEBI:77746) |
| creatine (CHEBI:16919) has role mouse metabolite (CHEBI:75771) |
| creatine (CHEBI:16919) has role neuroprotective agent (CHEBI:63726) |
| creatine (CHEBI:16919) has role nutraceutical (CHEBI:50733) |
| creatine (CHEBI:16919) is a glycine derivative (CHEBI:24373) |
| creatine (CHEBI:16919) is a guanidines (CHEBI:24436) |
| creatine (CHEBI:16919) is conjugate acid of creatinate (CHEBI:66924) |
| creatine (CHEBI:16919) is tautomer of creatine zwitterion (CHEBI:57947) |
| Incoming Relation(s) |
| N-phosphocreatine (CHEBI:17287) has functional parent creatine (CHEBI:16919) |
| creatinine (CHEBI:16737) has functional parent creatine (CHEBI:16919) |
| creatinate (CHEBI:66924) is conjugate base of creatine (CHEBI:16919) |
| creatine zwitterion (CHEBI:57947) is tautomer of creatine (CHEBI:16919) |
| IUPAC Name |
|---|
| N-[amino(imino)methyl]-N-methylglycine |
| Synonyms | Source |
|---|---|
| Creatine | KEGG COMPOUND |
| alpha-Methylguanidino acetic acid | KEGG COMPOUND |
| Methylglycocyamine | KEGG COMPOUND |
| (N-methylcarbamimidamido)acetic acid | ChEBI |
| N-[(E)-AMINO(IMINO)METHYL]-N-METHYLGLYCINE | PDBeChem |
| (α-methylguanido)acetic acid | NIST Chemistry WebBook |
| Citations |
|---|