EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18N4OS |
| Net Charge | 0 |
| Average Mass | 386.480 |
| Monoisotopic Mass | 386.12013 |
| SMILES | CNC(=O)c1ccccc1Sc1ccc2c(/C=C/c3ccccn3)nnc2c1 |
| InChI | InChI=1S/C22H18N4OS/c1-23-22(27)18-7-2-3-8-21(18)28-16-10-11-17-19(25-26-20(17)14-16)12-9-15-6-4-5-13-24-15/h2-14H,1H3,(H,23,27)(H,25,26)/b12-9+ |
| InChIKey | RITAVMQDGBJQJZ-FMIVXFBMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| axitinib (CHEBI:66910) has role antineoplastic agent (CHEBI:35610) |
| axitinib (CHEBI:66910) has role tyrosine kinase inhibitor (CHEBI:38637) |
| axitinib (CHEBI:66910) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| axitinib (CHEBI:66910) is a aryl sulfide (CHEBI:35683) |
| axitinib (CHEBI:66910) is a benzamides (CHEBI:22702) |
| axitinib (CHEBI:66910) is a indazoles (CHEBI:38769) |
| axitinib (CHEBI:66910) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| N-methyl-2-({3-[(E)-2-(pyridin-2-yl)ethenyl]-1H-indazol-6-yl}sulfanyl)benzamide |
| INNs | Source |
|---|---|
| axitinib | WHO MedNet |
| axitinib | WHO MedNet |
| axitinib | WHO MedNet |
| axitinibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| AG-013736 | ChemIDplus |
| N-methyl-2-({3-[(E)-2-(pyridin-2-yl)vinyl]-1H-indazol-6-yl}sulfanyl)benzamide | IUPAC |
| Brand Name | Source |
|---|---|
| Inlyta | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11333336 | Reaxys |
| CAS:319460-85-0 | KEGG DRUG |
| CAS:319460-85-0 | ChemIDplus |
| Citations |
|---|