EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N4O3 |
| Net Charge | -1 |
| Average Mass | 225.228 |
| Monoisotopic Mass | 225.09931 |
| SMILES | NCCC(=O)N[C@@H](Cc1cncn1)C(=O)[O-] |
| InChI | InChI=1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16)/p-1/t7-/m0/s1 |
| InChIKey | CQOVPNPJLQNMDC-ZETCQYMHSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carnosinate (CHEBI:66874) is a N-acyl-L-α-amino acid anion (CHEBI:59874) |
| carnosinate (CHEBI:66874) is conjugate base of carnosine (CHEBI:15727) |
| carnosinate (CHEBI:66874) is conjugate base of carnosine zwitterion (CHEBI:57485) |
| Incoming Relation(s) |
| carnosine (CHEBI:15727) is conjugate acid of carnosinate (CHEBI:66874) |
| carnosine zwitterion (CHEBI:57485) is conjugate acid of carnosinate (CHEBI:66874) |
| IUPAC Name |
|---|
| (2S)-2-(β-alanylamino)-3-(1H-imidazol-4-yl)propanoate |
| Synonyms | Source |
|---|---|
| carnosinate(1−) | ChEBI |
| carnosinate anion | ChEBI |
| Nα-(β-alanyl)-L-histidinate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6337985 | Reaxys |