EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N4O3 |
| Net Charge | 0 |
| Average Mass | 226.236 |
| Monoisotopic Mass | 226.10659 |
| SMILES | NCCC(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16)/t7-/m0/s1 |
| InChIKey | CQOVPNPJLQNMDC-ZETCQYMHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carnosine (CHEBI:15727) has role Daphnia magna metabolite (CHEBI:83056) |
| carnosine (CHEBI:15727) has role anticonvulsant (CHEBI:35623) |
| carnosine (CHEBI:15727) has role antineoplastic agent (CHEBI:35610) |
| carnosine (CHEBI:15727) has role antioxidant (CHEBI:22586) |
| carnosine (CHEBI:15727) has role antipsychotic agent (CHEBI:35476) |
| carnosine (CHEBI:15727) has role geroprotector (CHEBI:176497) |
| carnosine (CHEBI:15727) has role human metabolite (CHEBI:77746) |
| carnosine (CHEBI:15727) has role mouse metabolite (CHEBI:75771) |
| carnosine (CHEBI:15727) has role neuroprotective agent (CHEBI:63726) |
| carnosine (CHEBI:15727) is a dipeptide (CHEBI:46761) |
| carnosine (CHEBI:15727) is conjugate acid of carnosinate (CHEBI:66874) |
| carnosine (CHEBI:15727) is tautomer of carnosine zwitterion (CHEBI:57485) |
| Incoming Relation(s) |
| N-acetylcarnosine (CHEBI:67249) has functional parent carnosine (CHEBI:15727) |
| carnosinate (CHEBI:66874) is conjugate base of carnosine (CHEBI:15727) |
| carnosine zwitterion (CHEBI:57485) is tautomer of carnosine (CHEBI:15727) |
| IUPAC Name |
|---|
| Nα-(β-alanyl)-L-histidine |
| Synonyms | Source |
|---|---|
| (2S)-2-(3-aminopropanamido)-3-(1H-imidazol-4-yl)propanoic acid | IUPAC |
| beta-alanyl-L-histidine | ChEBI |
| Carnosine | KEGG COMPOUND |
| N-(3-aminopropanoyl)-L-histidine | ChEBI |
| N-β-alanyl-L-histidine | HMDB |
| ignotine | ChemIDplus |
| Brand Names | Source |
|---|---|
| Karnozin | ChemIDplus |
| Karnozzn | ChemIDplus |
| Citations |
|---|