EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15727 - carnosine
| Formula | C9H14N4O3 |
| Net Charge | 0 |
| Average Mass | 226.236 |
| Monoisotopic Mass | 226.10659 |
| SMILES | NCCC(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16)/t7-/m0/s1 |
| InChIKey | CQOVPNPJLQNMDC-ZETCQYMHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carnosine (CHEBI:15727) has role Daphnia magna metabolite (CHEBI:83056) |
| carnosine (CHEBI:15727) has role anticonvulsant (CHEBI:35623) |
| carnosine (CHEBI:15727) has role antineoplastic agent (CHEBI:35610) |
| carnosine (CHEBI:15727) has role antioxidant (CHEBI:22586) |
| carnosine (CHEBI:15727) has role geroprotector (CHEBI:176497) |
| carnosine (CHEBI:15727) has role human metabolite (CHEBI:77746) |
| carnosine (CHEBI:15727) has role mouse metabolite (CHEBI:75771) |
| carnosine (CHEBI:15727) has role neuroprotective agent (CHEBI:63726) |
| carnosine (CHEBI:15727) is a dipeptide (CHEBI:46761) |
| carnosine (CHEBI:15727) is conjugate acid of carnosinate (CHEBI:66874) |
| carnosine (CHEBI:15727) is tautomer of carnosine zwitterion (CHEBI:57485) |
| Incoming Relation(s) |
| N-acetylcarnosine (CHEBI:67249) has functional parent carnosine (CHEBI:15727) |
| carnosinate (CHEBI:66874) is conjugate base of carnosine (CHEBI:15727) |
| carnosine zwitterion (CHEBI:57485) is tautomer of carnosine (CHEBI:15727) |
| IUPAC Name |
|---|
| Nα-(β-alanyl)-L-histidine |
| Synonyms | Source |
|---|---|
| (2S)-2-(3-aminopropanamido)-3-(1H-imidazol-4-yl)propanoic acid | IUPAC |
| beta-alanyl-L-histidine | ChEBI |
| Carnosine | KEGG COMPOUND |
| N-(3-aminopropanoyl)-L-histidine | ChEBI |
| N-β-alanyl-L-histidine | HMDB |
| ignotine | ChemIDplus |
| Brand Names | Source |
|---|---|
| Karnozin | ChemIDplus |
| Karnozzn | ChemIDplus |
| Citations |
|---|