EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N4O3 |
| Net Charge | 0 |
| Average Mass | 226.236 |
| Monoisotopic Mass | 226.10659 |
| SMILES | NCCC(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16)/t7-/m0/s1 |
| InChIKey | CQOVPNPJLQNMDC-ZETCQYMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| ChEBI Ontology |
|---|
| IUPAC Name |
|---|
| Nα-(β-alanyl)-L-histidine |
| Synonyms | Source |
|---|---|
| Carnosine | KEGG COMPOUND |
| Nalpha-(beta-alanyl)-L-histidine | KEGG COMPOUND |
| L-carnosine | ChemIDplus |
| N-2-M | ChemIDplus |
| beta-alanyl-L-histidine | ChEBI |
| N-β-alanyl-L-histidine | HMDB |
| Brand Names | Source |
|---|---|
| Karnozin | ChemIDplus |
| Karnozzn | ChemIDplus |
| Citations |
|---|