EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H19N3O2 |
| Net Charge | 0 |
| Average Mass | 189.259 |
| Monoisotopic Mass | 189.14773 |
| SMILES | NCCCNCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H19N3O2/c9-4-2-6-11-5-1-3-7(10)8(12)13/h7,11H,1-6,9-10H2,(H,12,13)/t7-/m0/s1 |
| InChIKey | PUDIBYZCMYMCQI-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carboxyspermidine (CHEBI:66868) has parent hydride spermidine (CHEBI:16610) |
| carboxyspermidine (CHEBI:66868) is a L-ornithine derivative (CHEBI:21368) |
| carboxyspermidine (CHEBI:66868) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| carboxyspermidine (CHEBI:66868) is conjugate base of carboxyspermidine(2+) (CHEBI:65072) |
| Incoming Relation(s) |
| carboxyspermidine(2+) (CHEBI:65072) is conjugate acid of carboxyspermidine (CHEBI:66868) |
| IUPAC Name |
|---|
| (2S)-2-amino-5-[(3-aminopropyl)amino]pentanoic acid |
| Synonyms | Source |
|---|---|
| 2-Amino-4-[(4-aminobutyl)amino]-butanoic acid | KEGG COMPOUND |
| (2S)-2-azanyl-5-(3-azanylpropylamino)pentanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C18172 | KEGG COMPOUND |
| Citations |
|---|