EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H21N3O2 |
| Net Charge | +2 |
| Average Mass | 191.275 |
| Monoisotopic Mass | 191.16228 |
| SMILES | [NH3+]CCCC[NH2+]CC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C8H19N3O2/c9-4-1-2-5-11-6-3-7(10)8(12)13/h7,11H,1-6,9-10H2,(H,12,13)/p+2/t7-/m0/s1 |
| InChIKey | ICLFWLHIBPQMFT-ZETCQYMHSA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carboxyspermidine(2+) (CHEBI:65072) is a α-amino-acid cation (CHEBI:33719) |
| carboxyspermidine(2+) (CHEBI:65072) is conjugate acid of carboxyspermidine (CHEBI:66868) |
| Incoming Relation(s) |
| carboxyspermidine (CHEBI:66868) is conjugate base of carboxyspermidine(2+) (CHEBI:65072) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-5-[(3-azaniumylpropyl)azaniumyl]pentanoate |
| Synonym | Source |
|---|---|
| (2S)-2-ammonio-5-[(3-ammoniopropyl)ammonio]pentanoate | IUPAC |
| UniProt Name | Source |
|---|---|
| carboxyspermidine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-10012 | MetaCyc |
| Citations |
|---|