EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H40O9 |
| Net Charge | 0 |
| Average Mass | 640.729 |
| Monoisotopic Mass | 640.26723 |
| SMILES | [H][C@]12C[C@H](OC(=O)c3ccccc3)[C@]3(C)[C@@H](OC(C)=O)[C@@H](OC(=O)c4ccccc4)C[C@@H](C)[C@@]3(OC1(C)C)[C@@H]2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C38H40O9/c1-23-21-29(44-33(40)25-15-9-6-10-16-25)32(43-24(2)39)37(5)30(45-34(41)26-17-11-7-12-18-26)22-28-31(38(23,37)47-36(28,3)4)46-35(42)27-19-13-8-14-20-27/h6-20,23,28-32H,21-22H2,1-5H3/t23-,28-,29+,30+,31-,32+,37-,38-/m1/s1 |
| InChIKey | ULAZFRGMLIIKAD-MNRUEBDGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Celastrus orbiculatus (ncbitaxon:85181) | root (BTO:0001188) | PubMed (10346948) | |
| Microtropis fokienensis (ncbitaxon:1089417) | root (BTO:0001188) | PubMed (17315960) |
| Roles Classification |
|---|
| Biological Roles: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. |
| Applications: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orbiculin G (CHEBI:66828) has role antineoplastic agent (CHEBI:35610) |
| orbiculin G (CHEBI:66828) has role antitubercular agent (CHEBI:33231) |
| orbiculin G (CHEBI:66828) has role NF-κB inhibitor (CHEBI:73240) |
| orbiculin G (CHEBI:66828) has role plant metabolite (CHEBI:76924) |
| orbiculin G (CHEBI:66828) is a acetate ester (CHEBI:47622) |
| orbiculin G (CHEBI:66828) is a benzoate ester (CHEBI:36054) |
| orbiculin G (CHEBI:66828) is a bridged compound (CHEBI:35990) |
| orbiculin G (CHEBI:66828) is a cyclic ether (CHEBI:37407) |
| orbiculin G (CHEBI:66828) is a dihydroagarofuran sesquiterpenoid (CHEBI:71548) |
| orbiculin G (CHEBI:66828) is a organic heterotricyclic compound (CHEBI:26979) |
| Incoming Relation(s) |
| 15-acetoxyorbiculin G (CHEBI:65364) has functional parent orbiculin G (CHEBI:66828) |
| IUPAC Name |
|---|
| (3R,5S,5aR,6R,7S,9R,9aS,10R)-6-(acetyloxy)-2,2,5a,9-tetramethyloctahydro-2H-3,9a-methano-1-benzoxepine-5,7,10-triyl tribenzoate |
| Synonym | Source |
|---|---|
| 1β-acetoxy-2β,6α,9α-tribenzoyloxy-dihydro-β-agarofuran | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8373955 | Reaxys |
| Citations |
|---|