EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H42O11 |
| Net Charge | 0 |
| Average Mass | 698.765 |
| Monoisotopic Mass | 698.27271 |
| SMILES | [H][C@]12C[C@H](OC(=O)c3ccccc3)[C@]3(COC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(=O)c4ccccc4)C[C@@H](C)[C@@]3(OC1(C)C)[C@@H]2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C40H42O11/c1-24-21-31(48-35(43)27-15-9-6-10-16-27)34(47-26(3)42)39(23-46-25(2)41)32(49-36(44)28-17-11-7-12-18-28)22-30-33(40(24,39)51-38(30,4)5)50-37(45)29-19-13-8-14-20-29/h6-20,24,30-34H,21-23H2,1-5H3/t24-,30-,31+,32+,33-,34+,39-,40-/m1/s1 |
| InChIKey | YOWBCRNBOMRTPW-NPIRVHPYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microtropis japonica (ncbitaxon:1089418) | stem (BTO:0001300) | PubMed (18471021) |
| Roles Classification |
|---|
| Biological Roles: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-acetoxyorbiculin G (CHEBI:65364) has functional parent orbiculin G (CHEBI:66828) |
| 15-acetoxyorbiculin G (CHEBI:65364) has role antitubercular agent (CHEBI:33231) |
| 15-acetoxyorbiculin G (CHEBI:65364) has role metabolite (CHEBI:25212) |
| 15-acetoxyorbiculin G (CHEBI:65364) is a benzoate ester (CHEBI:36054) |
| 15-acetoxyorbiculin G (CHEBI:65364) is a bridged compound (CHEBI:35990) |
| 15-acetoxyorbiculin G (CHEBI:65364) is a cyclic ether (CHEBI:37407) |
| 15-acetoxyorbiculin G (CHEBI:65364) is a dihydroagarofuran sesquiterpenoid (CHEBI:71548) |
| 15-acetoxyorbiculin G (CHEBI:65364) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| (3R,5S,5aR,6R,7S,9R,9aS,10R)-6-(acetyloxy)-5a-[(acetyloxy)methyl]-2,2,9-trimethyloctahydro-2H-3,9a-methano-1-benzoxepine-5,7,10-triyl tribenzoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18842487 | Reaxys |
| Citations |
|---|