EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17NO2 |
| Net Charge | 0 |
| Average Mass | 255.317 |
| Monoisotopic Mass | 255.12593 |
| SMILES | COC(=O)c1ccccc1NCc1ccc(C)cc1 |
| InChI | InChI=1S/C16H17NO2/c1-12-7-9-13(10-8-12)11-17-15-6-4-3-5-14(15)16(18)19-2/h3-10,17H,11H2,1-2H3 |
| InChIKey | YBTJTIATNGZKEJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Onosma hispida (IPNI:119681-1) | whole plant (BTO:0001461) | PubMed (16079517) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| onosmin B (CHEBI:66822) has functional parent onosmin A (CHEBI:66821) |
| onosmin B (CHEBI:66822) has role lipoxygenase inhibitor (CHEBI:35856) |
| onosmin B (CHEBI:66822) has role metabolite (CHEBI:25212) |
| onosmin B (CHEBI:66822) is a benzoate ester (CHEBI:36054) |
| onosmin B (CHEBI:66822) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| methyl 2-[(4-methylbenzyl)amino]benzoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10075408 | Reaxys |
| Citations |
|---|