EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17NO2 |
| Net Charge | 0 |
| Average Mass | 255.317 |
| Monoisotopic Mass | 255.12593 |
| SMILES | COC(=O)c1ccccc1NCc1ccc(C)cc1 |
| InChI | InChI=1S/C16H17NO2/c1-12-7-9-13(10-8-12)11-17-15-6-4-3-5-14(15)16(18)19-2/h3-10,17H,11H2,1-2H3 |
| InChIKey | YBTJTIATNGZKEJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Onosma hispida (IPNI:119681-1) | whole plant (BTO:0001461) | PubMed (16079517) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| onosmin B (CHEBI:66822) has functional parent onosmin A (CHEBI:66821) |
| onosmin B (CHEBI:66822) has role lipoxygenase inhibitor (CHEBI:35856) |
| onosmin B (CHEBI:66822) has role metabolite (CHEBI:25212) |
| onosmin B (CHEBI:66822) is a benzoate ester (CHEBI:36054) |
| onosmin B (CHEBI:66822) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| methyl 2-[(4-methylbenzyl)amino]benzoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10075408 | Reaxys |
| Citations |
|---|