EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15NO2 |
| Net Charge | 0 |
| Average Mass | 241.290 |
| Monoisotopic Mass | 241.11028 |
| SMILES | Cc1ccc(CNc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C15H15NO2/c1-11-6-8-12(9-7-11)10-16-14-5-3-2-4-13(14)15(17)18/h2-9,16H,10H2,1H3,(H,17,18) |
| InChIKey | LLPMVUVDNDHOFH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Onosma hispida (IPNI:119681-1) | whole plant (BTO:0001461) | PubMed (16079517) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| onosmin A (CHEBI:66821) has functional parent anthranilic acid (CHEBI:30754) |
| onosmin A (CHEBI:66821) has role lipoxygenase inhibitor (CHEBI:35856) |
| onosmin A (CHEBI:66821) has role plant metabolite (CHEBI:76924) |
| onosmin A (CHEBI:66821) is a aminobenzoic acid (CHEBI:22495) |
| onosmin A (CHEBI:66821) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| onosmin B (CHEBI:66822) has functional parent onosmin A (CHEBI:66821) |
| IUPAC Name |
|---|
| 2-[(4-methylbenzyl)amino]benzoic acid |
| Synonym | Source |
|---|---|
| 2-[(4-methylphenyl)methylamino]benzoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2850992 | Reaxys |
| Citations |
|---|