EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H33NO5S |
| Net Charge | 0 |
| Average Mass | 435.586 |
| Monoisotopic Mass | 435.20794 |
| SMILES | [H][C@@]12CCC=C(C)[C@@]1(C)CC[C@H](C)[C@@]2(C)CC1=CC(=O)C(NCCS(=O)(=O)O)=CC1=O |
| InChI | InChI=1S/C23H33NO5S/c1-15-6-5-7-21-22(15,3)9-8-16(2)23(21,4)14-17-12-20(26)18(13-19(17)25)24-10-11-30(27,28)29/h6,12-13,16,21,24H,5,7-11,14H2,1-4H3,(H,27,28,29)/t16-,21+,22+,23+/m0/s1 |
| InChIKey | DTNJUMSQZGAJQJ-RAKGIWIYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dysidea avara (ncbitaxon:196820) | - | DOI (10.1021/jo00050a043) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| melemeleone B (CHEBI:66690) has functional parent taurine (CHEBI:15891) |
| melemeleone B (CHEBI:66690) has role metabolite (CHEBI:25212) |
| melemeleone B (CHEBI:66690) has role tyrosine kinase inhibitor (CHEBI:38637) |
| melemeleone B (CHEBI:66690) is a 1,4-benzoquinones (CHEBI:132124) |
| melemeleone B (CHEBI:66690) is a amino sulfonic acid (CHEBI:37793) |
| melemeleone B (CHEBI:66690) is a octahydronaphthalenes (CHEBI:138397) |
| melemeleone B (CHEBI:66690) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| 2-[(3,6-dioxo-4-{[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl]methyl}cyclohexa-1,4-dien-1-yl)amino]ethanesulfonic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5887590 | Reaxys |