EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H36O5 |
| Net Charge | 0 |
| Average Mass | 416.558 |
| Monoisotopic Mass | 416.25627 |
| SMILES | CC1=C(CC/C(C)=C/CCC2=CC[C@H](C3=CC(=O)O[C@H]3O)O[C@H]2O)C(C)(C)CCC1 |
| InChI | InChI=1S/C25H36O5/c1-16(10-12-20-17(2)8-6-14-25(20,3)4)7-5-9-18-11-13-21(29-23(18)27)19-15-22(26)30-24(19)28/h7,11,15,21,23-24,27-28H,5-6,8-10,12-14H2,1-4H3/b16-7+/t21-,23-,24-/m1/s1 |
| InChIKey | FGJIDQWRRLDGDB-CPIXEKRISA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Luffariella variabilis (WORMS:165365) | - | DOI (10.1016/S0040-4039(00)77766-5) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 5.99.1.2 (DNA topoisomerase) inhibitor A topoisomerase inhibitor that inhibits the bacterial enzymes of the DNA topoisomerases, Type I class (EC 5.99.1.2) that catalyze ATP-independent breakage of one of the two strands of DNA, passage of the unbroken strand through the break, and rejoining of the broken strand. These bacterial enzymes reduce the topological stress in the DNA structure by relaxing negatively, but not positively, supercoiled DNA. EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. EC 3.1.1.4 (phospholipase A2) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of phospholipase A2 (EC 3.1.1.4). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| manoalide (CHEBI:66666) has role EC 3.1.1.4 (phospholipase A2) inhibitor (CHEBI:50469) |
| manoalide (CHEBI:66666) has role EC 5.99.1.2 (DNA topoisomerase) inhibitor (CHEBI:50276) |
| manoalide (CHEBI:66666) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| manoalide (CHEBI:66666) has role metabolite (CHEBI:25212) |
| manoalide (CHEBI:66666) is a butenolide (CHEBI:50523) |
| manoalide (CHEBI:66666) is a lactol (CHEBI:38131) |
| manoalide (CHEBI:66666) is a sesterterpenoid (CHEBI:26660) |
| IUPAC Name |
|---|
| (5R)-5-hydroxy-4-{(2R,6R)-6-hydroxy-5-[(3E)-4-methyl-6-(2,6,6-trimethylcyclohex-1-en-1-yl)hex-3-en-1-yl]-3,6-dihydro-2H-pyran-2-yl}furan-2(5H)-one |
| Manual Xrefs | Databases |
|---|---|
| C17156 | KEGG COMPOUND |
| CA1297030 | Patent |
| LMPR0105020001 | LIPID MAPS |
| Manoalide | Wikipedia |
| US4839385 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10729444 | Reaxys |
| CAS:75088-80-1 | ChemIDplus |
| Citations |
|---|