EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:66636 - 14-norpseurotin A
| Formula | C21H23NO8 |
| Net Charge | 0 |
| Average Mass | 417.414 |
| Monoisotopic Mass | 417.14237 |
| SMILES | C/C=C\[C@H](O)[C@H](O)C1=C(C)C(=O)[C@]2(O1)C(=O)N[C@@](OC)(C(=O)c1ccccc1)[C@@H]2O |
| InChI | InChI=1S/C21H23NO8/c1-4-8-13(23)14(24)15-11(2)16(25)20(30-15)18(27)21(29-3,22-19(20)28)17(26)12-9-6-5-7-10-12/h4-10,13-14,18,23-24,27H,1-3H3,(H,22,28)/b8-4-/t13-,14-,18+,20+,21+/m0/s1 |
| InChIKey | FCGCMRDADMTJIM-LFDIKFNASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus sydowii (ncbitaxon:75750) | - | PubMed (18505285) | Strain: PFW1-13 |
| Roles Classification |
|---|
| Biological Roles: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14-norpseurotin A (CHEBI:66636) has functional parent pseurotin A (CHEBI:64535) |
| 14-norpseurotin A (CHEBI:66636) has role Aspergillus metabolite (CHEBI:76956) |
| 14-norpseurotin A (CHEBI:66636) has role antibacterial agent (CHEBI:33282) |
| 14-norpseurotin A (CHEBI:66636) has role antileishmanial agent (CHEBI:70868) |
| 14-norpseurotin A (CHEBI:66636) has role antineoplastic agent (CHEBI:35610) |
| 14-norpseurotin A (CHEBI:66636) is a alkaloid (CHEBI:22315) |
| 14-norpseurotin A (CHEBI:66636) is a azaspiro compound (CHEBI:35624) |
| 14-norpseurotin A (CHEBI:66636) is a lactam (CHEBI:24995) |
| 14-norpseurotin A (CHEBI:66636) is a oxaspiro compound (CHEBI:37948) |
| 14-norpseurotin A (CHEBI:66636) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (5S,8S,9R)-8-benzoyl-2-[(1S,2S,3Z)-1,2-dihydroxypent-3-en-1-yl]-9-hydroxy-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione |
| Manual Xrefs | Databases |
|---|---|
| 23329509 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18842462 | Reaxys |
| Citations |
|---|