EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:66636 - 14-norpseurotin A
| Formula | C21H23NO8 |
| Net Charge | 0 |
| Average Mass | 417.414 |
| Monoisotopic Mass | 417.14237 |
| SMILES | C/C=C\[C@H](O)[C@H](O)C1=C(C)C(=O)[C@]2(O1)C(=O)N[C@@](OC)(C(=O)c1ccccc1)[C@@H]2O |
| InChI | InChI=1S/C21H23NO8/c1-4-8-13(23)14(24)15-11(2)16(25)20(30-15)18(27)21(29-3,22-19(20)28)17(26)12-9-6-5-7-10-12/h4-10,13-14,18,23-24,27H,1-3H3,(H,22,28)/b8-4-/t13-,14-,18+,20+,21+/m0/s1 |
| InChIKey | FCGCMRDADMTJIM-LFDIKFNASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus sydowii (ncbitaxon:75750) | - | PubMed (18505285) | Strain: PFW1-13 |
| Roles Classification |
|---|
| Biological Roles: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14-norpseurotin A (CHEBI:66636) has functional parent pseurotin A (CHEBI:64535) |
| 14-norpseurotin A (CHEBI:66636) has role Aspergillus metabolite (CHEBI:76956) |
| 14-norpseurotin A (CHEBI:66636) has role antibacterial agent (CHEBI:33282) |
| 14-norpseurotin A (CHEBI:66636) has role antileishmanial agent (CHEBI:70868) |
| 14-norpseurotin A (CHEBI:66636) has role antineoplastic agent (CHEBI:35610) |
| 14-norpseurotin A (CHEBI:66636) is a alkaloid (CHEBI:22315) |
| 14-norpseurotin A (CHEBI:66636) is a azaspiro compound (CHEBI:35624) |
| 14-norpseurotin A (CHEBI:66636) is a lactam (CHEBI:24995) |
| 14-norpseurotin A (CHEBI:66636) is a oxaspiro compound (CHEBI:37948) |
| 14-norpseurotin A (CHEBI:66636) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (5S,8S,9R)-8-benzoyl-2-[(1S,2S,3Z)-1,2-dihydroxypent-3-en-1-yl]-9-hydroxy-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione |
| Manual Xrefs | Databases |
|---|---|
| 23329509 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18842462 | Reaxys |
| Citations |
|---|