EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25NO8 |
| Net Charge | 0 |
| Average Mass | 431.441 |
| Monoisotopic Mass | 431.15802 |
| SMILES | CC/C=C\[C@H](O)[C@H](O)C1=C(C)C(=O)[C@]2(O1)C(=O)N[C@@](OC)(C(=O)c1ccccc1)[C@@H]2O |
| InChI | InChI=1S/C22H25NO8/c1-4-5-11-14(24)15(25)16-12(2)17(26)21(31-16)19(28)22(30-3,23-20(21)29)18(27)13-9-7-6-8-10-13/h5-11,14-15,19,24-25,28H,4H2,1-3H3,(H,23,29)/b11-5-/t14-,15-,19+,21+,22+/m0/s1 |
| InChIKey | SLYDIPAXCVVRNY-UOWMTANKSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pseurotin A (CHEBI:64535) has role metabolite (CHEBI:25212) |
| pseurotin A (CHEBI:64535) is a azaspiro compound (CHEBI:35624) |
| pseurotin A (CHEBI:64535) is a lactam (CHEBI:24995) |
| pseurotin A (CHEBI:64535) is a oxaspiro compound (CHEBI:37948) |
| Incoming Relation(s) |
| 14-norpseurotin A (CHEBI:66636) has functional parent pseurotin A (CHEBI:64535) |
| IUPAC Name |
|---|
| (5S,8S,9R)-8-benzoyl-2-[(1S,2S,3Z)-1,2-dihydroxyhex-3-en-1-yl]-9-hydroxy-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione |
| Synonym | Source |
|---|---|
| Pseurotin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18900004 | Reaxys |
| CAS:58523-30-1 | ChemIDplus |
| Citations |
|---|