EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O |
| Net Charge | 0 |
| Average Mass | 216.324 |
| Monoisotopic Mass | 216.15142 |
| SMILES | [H][C@]12CC[C@@](C)(c3ccc(C)cc3O)[C@@]1(C)C2 |
| InChI | InChI=1S/C15H20O/c1-10-4-5-12(13(16)8-10)14(2)7-6-11-9-15(11,14)3/h4-5,8,11,16H,6-7,9H2,1-3H3/t11-,14+,15+/m1/s1 |
| InChIKey | XQATUTRQDIODTL-UGFHNGPFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aplysia kurodai (ncbitaxon:6501) | - | PubMed (11302194) | |
| Palisada intermedia (ncbitaxon:397057) | - | DOI (10.1016/S0040-4020(01)92906-0) | Species also known as Laurencia intermedia. |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that interferes with the action of Na+/K+-transporting ATPase (EC 3.6.3.9). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| debromolaurinterol (CHEBI:66556) has functional parent laurinterol (CHEBI:66555) |
| debromolaurinterol (CHEBI:66556) has role antimicrobial agent (CHEBI:33281) |
| debromolaurinterol (CHEBI:66556) has role EC 3.6.3.9 (Na+/K+-transporting ATPase) inhibitor (CHEBI:63510) |
| debromolaurinterol (CHEBI:66556) has role metabolite (CHEBI:25212) |
| debromolaurinterol (CHEBI:66556) is a phenols (CHEBI:33853) |
| debromolaurinterol (CHEBI:66556) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| 2-[(1S,2R,5R)-1,2-dimethylbicyclo[3.1.0]hex-2-yl]-5-methylphenol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2050843 | Reaxys |
| Citations |
|---|