EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O |
| Net Charge | 0 |
| Average Mass | 216.324 |
| Monoisotopic Mass | 216.15142 |
| SMILES | [H][C@]12CC[C@@](C)(c3ccc(C)cc3O)[C@@]1(C)C2 |
| InChI | InChI=1S/C15H20O/c1-10-4-5-12(13(16)8-10)14(2)7-6-11-9-15(11,14)3/h4-5,8,11,16H,6-7,9H2,1-3H3/t11-,14+,15+/m1/s1 |
| InChIKey | XQATUTRQDIODTL-UGFHNGPFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aplysia kurodai (ncbitaxon:6501) | - | PubMed (11302194) | |
| Palisada intermedia (ncbitaxon:397057) | - | DOI (10.1016/S0040-4020(01)92906-0) | Species also known as Laurencia intermedia. |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that interferes with the action of Na+/K+-transporting ATPase (EC 3.6.3.9). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| debromolaurinterol (CHEBI:66556) has functional parent laurinterol (CHEBI:66555) |
| debromolaurinterol (CHEBI:66556) has role antimicrobial agent (CHEBI:33281) |
| debromolaurinterol (CHEBI:66556) has role EC 3.6.3.9 (Na+/K+-transporting ATPase) inhibitor (CHEBI:63510) |
| debromolaurinterol (CHEBI:66556) has role metabolite (CHEBI:25212) |
| debromolaurinterol (CHEBI:66556) is a phenols (CHEBI:33853) |
| debromolaurinterol (CHEBI:66556) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| 2-[(1S,2R,5R)-1,2-dimethylbicyclo[3.1.0]hex-2-yl]-5-methylphenol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2050843 | Reaxys |
| Citations |
|---|